(most pages are English only)

Table of proton affinities in alphabetical order

This is a list of compounds with proton affinities greater than that of water sorted by name. You can use your browser text search (usually available by typing Ctrl F) to help you find compounds of interest.

Compound Proton Affinity
((CH3)2N)2C=N-(4-CH3O-C6H4) 1047.7 kJ/mol
((CH3)2N)2C=N-(4-CH3-C6H4) 1044.3 kJ/mol
((CH3)2N)2C=N(4-FC6H4) 1030.1 kJ/mol
((CH3)2N)2C=N(4-ClC6H4) 1028.0 kJ/mol
((CH3)2N)2C=N(i-C3H7) 1055.6 kJ/mol
((CH3)2N)2C=N(t-C4H9) 1061.9 kJ/mol
((CH3)2N)2C=NC2H5 1051.4 kJ/mol
((CH3)2N)2C=N-C6H5 1038.5 kJ/mol
((CH3)2SiH)2O 845.2 kJ/mol
(?5-Cyclopentadienyl)dicarbonylrhodium 882.4 kJ/mol
(1-adamantyl)2CS 912.1 kJ/mol
(C12H25(OC2H4)7OH 1006.7 kJ/mol
(C2H5)(i-C3H7)NH 959.8 kJ/mol
(C2H5)2N-C(CH3)=N(n-C3H7) 1038.1 kJ/mol
(C2H5)3PO 936.8 kJ/mol
(C2H5)3SiOH 822.2 kJ/mol
(C5H5)Cr(CO)3CH3 859.8 kJ/mol
(C6H5)3AsO 906.3 kJ/mol
(C6H5)3PO 906.3 kJ/mol
(C6H5)3PS 906.3 kJ/mol
(C6H5CH2)Cr(CO)3 852.3 kJ/mol
(c-C3H5)2CS 904.2 kJ/mol
(CD3)2O 780.3 kJ/mol
(CF3CH2)2NH 838.1 kJ/mol
(CF3CH2)2O 702.5 kJ/mol
(CH2)5PCH3 969.4 kJ/mol
(CH2=CHCH2)2O 827.6 kJ/mol
(CH3)2(C6H5)PO 908.8 kJ/mol
(CH3)2(n-C3H7)N 962.7 kJ/mol
(CH3)2(t-C4H9)SiN(CH3)2 969.9 kJ/mol
(CH3)2C=C(CH3)C(CH3)=CH2 869.9 kJ/mol
(CH3)2C=CHC(CH3)=CH2 886.6 kJ/mol
(CH3)2C=NC2H5 976.1 kJ/mol
(CH3)2Ge=CH2 851.0 kJ/mol
(CH3)2N(CH2)4N(CH3)2 1046.4 kJ/mol
(CH3)2N(CH2)6N(CH3)2 1036.0 kJ/mol
(CH3)2N-C(4-CH3-C6H4)=NCH3 1038.1 kJ/mol
(CH3)2N-C(C2H5)=N(i-C3H7) 1036.8 kJ/mol
(CH3)2N-C(C2H5)=N(n-C5H11) 1038.1 kJ/mol
(CH3)2N-C(C2H5)=N(t-C4H9) 1043.5 kJ/mol
(CH3)2NC(C2H5)=CHCH3 991.6 kJ/mol
(CH3)2N-C(C6H5)=NCH3 1033.4 kJ/mol
(CH3)2NC(CH3)=CHCH3 1005.4 kJ/mol
(CH3)2N-C(CH3)=NCH3 1023.4 kJ/mol
(CH3)2N-C(CH3)=N(n-C6H13) 1033.4 kJ/mol
(CH3)2N-C(CH3)=N(n-C5H11) 1034.7 kJ/mol
(CH3)2N-C(CH3)=N(i-C3H7) 1031.8 kJ/mol
(CH3)2N-C(CH3)=N(n-C3H7) 1030.1 kJ/mol
(CH3)2N-C(CH3)=N(t-C4H9) 1038.5 kJ/mol
(CH3)2N-C(CH3)=N(c-C3H5) 1024.2 kJ/mol
(CH3)2N-C(CH3)=N(CH2)2OCH3 1036.4 kJ/mol
(CH3)2N-C(CH3)=NC2H5 1029.3 kJ/mol
(CH3)2NC(CH3)=N-(CH2)3N(CH3)2 1077.4 kJ/mol
(CH3)2NC(CH3)=N(CH2)2N(CH3)2 1048.5 kJ/mol
(CH3)2NC(CH3)=N(1-Ad) 1050.6 kJ/mol
(CH3)2NC6H4(t-C4H9) 961.1 kJ/mol
(CH3)2NCH=CH2 956.9 kJ/mol
(CH3)2N-CH=N-(1-Ad) 1033.4 kJ/mol
(CH3)2N-CH=N-(1-methylethyl) 1013.4 kJ/mol
(CH3)2N-CH=N-(1-methylpropyl) 1018.0 kJ/mol
(CH3)2N-CH=N-(1,1-dimethylpropyl) 1022.2 kJ/mol
(CH3)2N-CH=N-(2-propenyl) 1005.0 kJ/mol
(CH3)2N-CH=N-(2-propynyl) 993.3 kJ/mol
(CH3)2N-CH=N-(2-methylpropyl) 1014.6 kJ/mol
(CH3)2N-CH=N-(2-methoxyethyl) 1018.8 kJ/mol
(CH3)2N-CH=N-(4-cyanophenyl) 952.3 kJ/mol
(CH3)2N-CH=N-(4-acetylphenyl) 979.9 kJ/mol
(CH3)2N-CH=N-(4-bromophenyl) 981.1 kJ/mol
(CH3)2N-CH=N-(4-methylphenyl) 988.7 kJ/mol
(CH3)2N-CH=N-(4-nitrophenyl) 950.2 kJ/mol
(CH3)2N-CH=N-(c-propyl) 1006.3 kJ/mol
(CH3)2N-CH=N-(c-hexyl) 1020.5 kJ/mol
(CH3)2N-CH=N-(CH2)3N(CH3)2 1057.7 kJ/mol
(CH3)2N-CH=N(CH2)2N(CH3)2 1028.8 kJ/mol
(CH3)2N-CH=N-(n-propyl) 1011.7 kJ/mol
(CH3)2N-CH=N-(n-butyl) 1012.9 kJ/mol
(CH3)2N-CH=N-(n-hexyl) 1017.5 kJ/mol
(CH3)2N-CH=N(n-C5H11) 1018.0 kJ/mol
(CH3)2N-CH=N-(phenylmethyl) 1014.2 kJ/mol
(CH3)2N-CH=N(t-C4H9) 1020.9 kJ/mol
(CH3)2N-CH=N-C2H5 1008.8 kJ/mol
(CH3)2N-CH=N-CH2CN 948.1 kJ/mol
(CH3)2N-CH=N-CH2CH2CN 980.7 kJ/mol
(CH3)2N-CH=N-CH2CF3 966.1 kJ/mol
(CH3)2N-CH=N-CH3 1002.5 kJ/mol
(CH3)2N-CH=N-OCH3 948.1 kJ/mol
(CH3)2N-CH=N-phenyl 983.7 kJ/mol
(CH3)2NCOCN 828.9 kJ/mol
(CH3)2NCOOC2H5 896.6 kJ/mol
(CH3)2NCOOCH3 878.2 kJ/mol
(CH3)2Pb=CH2 938.1 kJ/mol
(CH3)2Sn=CH2 893.7 kJ/mol
(Ch3)3cch2N(ch3)2 970.7 kJ/mol
(CH3)3CONO 864.0 kJ/mol
(CH3)3Si(CH2)2N(CH3)2 980.3 kJ/mol
(CH3)3Si(CH2)3N(CH3)2 980.3 kJ/mol
(Ch3)3sin(ch3)2 966.9 kJ/mol
(CO)6V 800.0 kJ/mol
(E)-Dimethyldiazene 865.3 kJ/mol
(i-C3H7)2(C2H5)N 994.1 kJ/mol
(i-C3H7)3PO 954.4 kJ/mol
(i-C3H7)N(C2H5)2 996.2 kJ/mol
(n-C3H7)2(CH3)P 983.7 kJ/mol
(sec-C4H9)(CH3)2N 975.7 kJ/mol
(t-C4H9)2CS 882.0 kJ/mol
(t-C4H9)2NH 987.8 kJ/mol
(t-C4H9)C(CH3)2N(CH3)2 982.4 kJ/mol
(t-C5H11)(CH3)2N 982.4 kJ/mol
(Z) CH3CH=C(CH3)COOH 822.6 kJ/mol
(Z)-1-Phenylpropene 836.4 kJ/mol
?5-Cyclopentadienylnitrosylnickel 827.2 kJ/mol
?-Butyrolactone 840.1 kJ/mol
[(C5H5)(CO)Fe]2(:-CO)(:-C=CH2) 982.0 kJ/mol
1-(1-adamantyl)pyrazole 954.4 kJ/mol
1-(2,3-dihydro-5-benzofuranyl)-ethanone 902.5 kJ/mol
1-(3-pyridinyl-1-oxide)ethanone 912.9 kJ/mol
1,1-(Dimethylthio)ethene 930.9 kJ/mol
1,1,1-Trifluorotrimethylamine 802.9 kJ/mol
1,16-Dimethyldodecahedrane 876.5 kJ/mol
1,1'-Biphenyl, 2-methyl- 815.9 kJ/mol
1,1'-Biphenyl, 3-methyl- 828.0 kJ/mol
1,1'-Biphenyl, 4-methyl- 818.0 kJ/mol
1,1'-Bipiperidine 981.1 kJ/mol
1,1'-Diadamantyl ketone 894.1 kJ/mol
1,2,3-Propanetriol 874.9 kJ/mol
1,2,3-Trifluorobenzene 724.3 kJ/mol
1,2,4-Trifluorobenzene 729.7 kJ/mol
1,2-Benzenediamine 896.6 kJ/mol
1,2-Benzenediamine, N,N,N',N'-tetramethyl- 982.4 kJ/mol
1,2-Butadiene 779.1 kJ/mol
1,2-Diazabicyclo[2.2.2]octane, 2-methyl- 969.0 kJ/mol
1,2-Ethanediamine, N,N,N',N'-tetramethyl- 1012.9 kJ/mol
1,2-Ethanediol 815.9 kJ/mol
1,2-Propadiene 775.3 kJ/mol
1,3,2-Dioxaphospholane,2-methoxy- 895.0 kJ/mol
1,3,2-Dioxaphosphorinane,2-methoxy-4,6-dimethyl-(2a,4a,6a)- 951.4 kJ/mol
1,3,2-Dioxaphosphorinane,2-methoxy-4,6-dimethyl-(2,4a,6a)- 946.4 kJ/mol
1,3,2-Dioxaphosphorinane,2-methoxy- 925.5 kJ/mol
1,3,3-Trimethylcyclopropene 895.4 kJ/mol
1,3,5-Triazine 848.9 kJ/mol
1,3,5-Trifluorobenzene 741.8 kJ/mol
1,3,5-Trimethoxybenzene 926.8 kJ/mol
1,3,5-Trimethylpyrazole 949.3 kJ/mol
1,3-Benzenediamine 930.1 kJ/mol
1,3-Benzenedicarbonitrile 779.5 kJ/mol
1,3-Benzenedicarboxylic acid dimethyl ester 843.5 kJ/mol
1,3-Butadiene 783.2 kJ/mol
1,3-Butadiene, 2,3-dimethyl- 835.1 kJ/mol
1,3-Butadiene, 2-methyl- 826.3 kJ/mol
1,3-Butadiyne 737.2 kJ/mol
1,3-Cyclohexadiene 836.8 kJ/mol
1,3-Cyclohexanedione 881.2 kJ/mol
1,3-Cyclopentadiene 821.7 kJ/mol
1,3-di-(t-C4H9)-5-CH3-C6H3 853.5 kJ/mol
1,3-Diazine 885.8 kJ/mol
1,3-Dimethyl-2-imidazolidinone 918.4 kJ/mol
1,3-dimethyl-5-ethoxycarbonylpyrazole 925.1 kJ/mol
1,3-dimethyl-5-phenylpyrazole 956.5 kJ/mol
1,3-Dimethylpyrazole 933.9 kJ/mol
1,3-Dioxane 825.5 kJ/mol
1,3-Pentadiene, (E)- 834.3 kJ/mol
1,3-Pentadiene, 2-methyl- 864.8 kJ/mol
1,3-Propanediamine 987.0 kJ/mol
1,3-Propanediamine, N,N-dimethyl- 1025.1 kJ/mol
1,3-Propanediamine, N,N,N',N'-tetramethyl- 1035.1 kJ/mol
1,3-Propanediol 876.1 kJ/mol
1,4,4-(CH3)3-1,2,3,4-tetrahydropyridine 979.9 kJ/mol
1,4,4-Trimethylpiperidine 965.7 kJ/mol
1,4,5,6-Tetrahydropyrimidine 1002.1 kJ/mol
1,4,7,10,13,16-Hexaoxacyclooctadecane 966.9 kJ/mol
1,4-Benzenediamine 905.8 kJ/mol
1,4-Benzenediamine, N,N-dimethyl- 955.2 kJ/mol
1,4-Benzenedicarbonitrile 779.1 kJ/mol
1,4-Benzenedicarboxylic acid dimethyl ester 843.1 kJ/mol
1,4-butanediamine 1005.4 kJ/mol
1,4-Butanediol 915.5 kJ/mol
1,4-Cyclohexadiene 836.8 kJ/mol
1,4-Cyclohexadiene,3,6-bis(methylene)- 900.4 kJ/mol
1,4-Cyclohexanedione 812.5 kJ/mol
1,4-dimethyl-3,5-di-t-butylpyrazole 979.5 kJ/mol
1,4-Dimethylimidazole 976.5 kJ/mol
1,4-Dimethylpyrazole 928.4 kJ/mol
1,4-Dioxane 797.5 kJ/mol
1,4-Dioxin, 2,3-dihydro- 823.4 kJ/mol
1,4-Dioxyl radical 803.3 kJ/mol
1,5,7-triazabicyclo [4.4.0]dec-5-ene 1054.8 kJ/mol
1,5-Diaminopentane 999.6 kJ/mol
1,5-Diazabicyclo[3.3.3]undecane 971.1 kJ/mol
1,5-diazabicyclo[4.3.0]non-5-ene 1038.5 kJ/mol
1,5-diazabicyclo[4.4.0]dec-6-ene (DBD) 1046.4 kJ/mol
1,5-dimethyl-3-ethoxycarbonylpyrazole 933.5 kJ/mol
1,5-dimethyl-3-phenylpyrazole 954.4 kJ/mol
1,5-Dimethylimidazole 977.8 kJ/mol
1,5-Dimethylpyrazole 934.3 kJ/mol
1,5-Diphenylpentane 824.7 kJ/mol
1,6-Diazabicyclo[4.4.4]tetradecane 947.3 kJ/mol
1,6-Diazabicyclo[4.4.0]decane 978.6 kJ/mol
1,6-Dicarbahexaborane(6) 864.0 kJ/mol
1,6-Diphenylhexane 825.9 kJ/mol
1,6-Hexanediamine 999.6 kJ/mol
1,7-Diaminoheptane 998.3 kJ/mol
1,8-diazabicyclo [5.4.0]undec-7-ene 1048.1 kJ/mol
1,8-Naphthalenediamine, N,N,N',N'-tetramethyl- 1028.0 kJ/mol
1,8-Naphthalenediamine 944.3 kJ/mol
10,5-metheno-5H-bisazepino[1,2-d:2',1'-g][1,4]diazepine,7,8-dihydro 962.7 kJ/mol
11,5-metheno-5H,7H-bisazepino[1,2-a:2',1'-d][1,5]diazocine,8,9-dihydro 974.5 kJ/mol
12,5-metheno-5H-bisazepino[1,2-a:2',1'-d][1,5]diazonine,7,8,9,10-tetrahydro 972.8 kJ/mol
12-Crown-4 927.2 kJ/mol
13,5-metheno-5H,7H-bisazepino[1,2-a:2',1'-d][1,5]diazecine,8,9,10,11-tetrahydro 994.1 kJ/mol
14,5-metheno-5H-bisazepino[1,2-a:2',1'-d][1,5]diazacycloundecine,7,8,9,10,11,12- hexahydro 978.6 kJ/mol
15,16-diazatricyclo[8.4.1.13,8]hexadeca-1,3,5,7,9,11,13-heptaene,15,16-dimethyl 984.5 kJ/mol
15,16-diazatricyclo[8.4.1.13,8]hexadeca-1,3,5,7,9,11,13-heptaene 983.7 kJ/mol
15-Crown-5 943.9 kJ/mol
1-Adamantanecarboxamide 912.9 kJ/mol
1-Adamantyl methyl ketone 864.8 kJ/mol
1-Azabicyclo[1.1.0]butane 887.0 kJ/mol
1-Azabicyclo[2.2.2]oct-2-ene 969.4 kJ/mol
1-Azabicyclo[2.2.2]octane,4-N,N-dimethylamino- 984.1 kJ/mol
1-Azabicyclo[2.2.2]octan-3-one 936.0 kJ/mol
1-Azabicyclo[2.2.2]octane-4-carbonitrile 933.0 kJ/mol
1-Azabicyclo[2.2.2]octane, 3-methylene 977.4 kJ/mol
1-Azabicyclo[2.2.2]octane, 4-methyl- 979.5 kJ/mol
1-azabicyclo[2.2.2]-octane, 3-methyl 982.4 kJ/mol
1-azabicyclo[2.2.2]-octane, 3-cyano 935.5 kJ/mol
1-azabicyclo[2.2.2]-octane, 2-chloro 950.6 kJ/mol
1-azabicyclo[2.2.2]-octane, 2-cyano 926.3 kJ/mol
1-azabicyclo[2.2.2]-octane, 2-methyl 987.0 kJ/mol
1-Azabicyclo[3.3.3]undecane 978.6 kJ/mol
1-Azabicyclo[4.4.4]tetradecane 897.0 kJ/mol
1-Butanamine 921.3 kJ/mol
1-Butanamine, N-butyl- 968.6 kJ/mol
1-Butanamine, N,N-dimethyl- 969.0 kJ/mol
1-Butanethiol 801.7 kJ/mol
1-Butanol 789.1 kJ/mol
1-Butyne, 3-methyl- 815.0 kJ/mol
1-Cyclopropyl-2-methylbenzene 840.6 kJ/mol
1-Decanamine 930.5 kJ/mol
1H,5H-Pyrazolo[1,2-a]pyrazole,tetrahydro- 977.8 kJ/mol
1H-1,2,3-Triazole 879.5 kJ/mol
1H-1,2,4-Triazole 886.2 kJ/mol
1H-1,2-Diazepine, hexahydro-1,2-dimethyl 966.9 kJ/mol
1-H-Azepine, hexahydro-1-phenyl 956.5 kJ/mol
1H-Azepine, hexahydro- 956.9 kJ/mol
1H-Benzimidazole 954.0 kJ/mol
1-Heptanamine 923.4 kJ/mol
1-Hexanamine 927.6 kJ/mol
1-Hexene 805.0 kJ/mol
1-Hexyne 800.0 kJ/mol
1H-Imidazole 942.7 kJ/mol
1H-Imidazole, 1-methyl- 959.4 kJ/mol
1H-Imidazole, 1,2-dimethyl- 984.5 kJ/mol
1H-Imidazole, 2-methyl- 963.6 kJ/mol
1H-Imidazole-4-ethanamine, N,N-dimethyl- 1022.2 kJ/mol
1H-Indazole 900.8 kJ/mol
1H-Indole, 2,3-dihydro- 957.3 kJ/mol
1H-Purine, 6-methyl- 939.3 kJ/mol
1H-Pyrazole 894.1 kJ/mol
1H-Pyrazole, 3,5-dimethyl- 933.5 kJ/mol
1H-Pyrrole, 2,5-dimethyl- 918.8 kJ/mol
1H-Pyrrolo[2,3-b]pyridine 940.1 kJ/mol
1-Methoxycyclohexane 840.6 kJ/mol
1-Methyl-2,6-t-butylpiperidine 1011.3 kJ/mol
1-methyl-3,5-di-t-butylpyrazole 970.7 kJ/mol
1-methyl-3,5-diethoxycarbonylpyrazole 913.4 kJ/mol
1-methyl-3,5-dinitropyrazole 788.7 kJ/mol
1-methyl-3,5-diphenylpyrazole 959.0 kJ/mol
1-methyl-3-aminopyrazole 937.2 kJ/mol
1-Methyl-3-methylenecyclobutene 891.2 kJ/mol
1-methyl-3-nitropyrazole 847.7 kJ/mol
1-methyl-3-phenylpyrazole 932.6 kJ/mol
1-methyl-3-t-butylpyrazole 944.3 kJ/mol
1-methyl-5-aminopyrazole 949.3 kJ/mol
1-Methyl-5-nitroimidazole 895.4 kJ/mol
1-methyl-5-nitropyrazole 850.2 kJ/mol
1-methyl-5-phenylpyrazole 932.2 kJ/mol
1-methyl-5-t-butylpyrazole 939.3 kJ/mol
1-methylbenzimidazole 966.9 kJ/mol
1-methylbenzotriazole 931.4 kJ/mol
1-Methylcyclopropene 856.0 kJ/mol
1-Methylethenylamine 941.8 kJ/mol
1-methylindazole 922.6 kJ/mol
1-methylpyrazole 912.1 kJ/mol
1-Naphthalenamine 907.1 kJ/mol
1-Octanamine 928.8 kJ/mol
1-Pentanamine 923.4 kJ/mol
1-Phenylethyl radical 836.4 kJ/mol
1-Piperidinyloxy, 2,2,6,6-tetramethyl- 882.4 kJ/mol
1-Propanamine 918.0 kJ/mol
1-Propanamine, 2-methyl- 924.7 kJ/mol
1-Propanamine, 2-methyl-N-(2-methylpropyl)- 958.1 kJ/mol
1-Propanamine, N,N-dipropyl- 991.2 kJ/mol
1-Propanamine, N,N-diethyl- 978.6 kJ/mol
1-Propanamine, n-propyl- 962.3 kJ/mol
1-Propanethiol 795.0 kJ/mol
1-Propanethiol, 2,2-dimethyl- 809.6 kJ/mol
1-Propanethiol, 2-methyl- 802.5 kJ/mol
1-Propanol 786.6 kJ/mol
1-Propanol, 2,2-dimethyl- 795.4 kJ/mol
1-Propanol, 2-methyl- 793.7 kJ/mol
1-Propanol, 3-amino- 962.3 kJ/mol
1-Propanone, 1-phenyl- 867.3 kJ/mol
1-Propen-1-amine, N,N,2-trimethyl- 966.9 kJ/mol
1-Propene, 2-methyl- 802.1 kJ/mol
1-Propene, 2-methoxy- 895.0 kJ/mol
1-Propene, 3-ethoxy- 833.9 kJ/mol
1-Propyne, 3,3'-oxybis- 784.1 kJ/mol
1-t-Butylimidazole 987.0 kJ/mol
2(1H)-Pyridinone, 1-methyl- 925.9 kJ/mol
2(1H)-Pyrimidinone 872.8 kJ/mol
2(1H)-Pyrimidinone, 4-amino- 949.8 kJ/mol
2-(C3H7)-pyridine 955.6 kJ/mol
2-(CF3)-pyridine 887.0 kJ/mol
2-(CH3OCH2)-pyridine 958.1 kJ/mol
2-(i-C3H7)-pyridine 956.5 kJ/mol
2-(t-C4H9)-pyridine 961.9 kJ/mol
2,2,2-Trifluoroethylamine 846.8 kJ/mol
2,2,2-Trifluoroethyl formate 745.6 kJ/mol
2,2,2-Trifluoroethyl methyl ether 747.7 kJ/mol
2,2,4-Trimethyl-3-pentanone 856.9 kJ/mol
2,2-Dimethyltetrahydrofuran 847.7 kJ/mol
2,3-(CH3)=C6H3-COCH3 874.5 kJ/mol
2,3-(CH3)2-C6H3-COOCH3 863.6 kJ/mol
2,3,4,5-tetramethylfuran 915.5 kJ/mol
2,3,5,6-(CH3)4-C6H-COOCH3 865.3 kJ/mol
2,3,5-Trimethylimidazo(1,2-a)-pyridine 1005.4 kJ/mol
2,3-Butanedione 802.1 kJ/mol
2,3-Cyclobutenopyridine 954.0 kJ/mol
2,3-Diazabicyclo[2.2.1]heptane, 2,3-dimethyl- 977.8 kJ/mol
2,3-Diazabicyclo[2.2.2]octane, 2,3-dimethyl- 980.7 kJ/mol
2,3-Dimethylimidazo(1,2-a)pyridine 998.3 kJ/mol
2',3'-O-Isopropylideneuridine 874.0 kJ/mol
2,4-(CH3)2-C6H3-COOCH3 868.2 kJ/mol
2,4-(CH3)2C6H3-COCH3 882.4 kJ/mol
2,4-(t-C4H9)2 -pyridine 983.7 kJ/mol
2,4,6-(CH3)3-C6H2-COOCH3 866.5 kJ/mol
2,4,6-Cycloheptatrien-1-one 920.9 kJ/mol
2,4-Dicarbaheptaborane(7) 697.5 kJ/mol
2,4-Dimethylfuran 894.5 kJ/mol
2,5-(CH3)2-C6H3-COOCH3 864.8 kJ/mol
2,5-(CH3)2C6H3-COCH3 873.6 kJ/mol
2,5,8,11-Tetraoxadodecane 946.4 kJ/mol
2,5-Dimethylimidazo(1,2-a)pyridine 996.2 kJ/mol
2,5-Norbornadiene 849.4 kJ/mol
2,6-(C2H5)2-pyridine 972.4 kJ/mol
2,6-(CH3)2-C6H3-COOCH3 855.2 kJ/mol
2,6-(CH3)2C6H3-COCH3 856.9 kJ/mol
2,6-(i-C3H7)2-pyridine 979.1 kJ/mol
2,6-(t-C4H9)2-pyridine 982.8 kJ/mol
2,6,7-Trioxa-1-phosphabicyclo[2.2.1]heptane 802.9 kJ/mol
2,6,7-Trioxa-1-phosphabicyclo[2.2.2]octane 868.6 kJ/mol
2,6-Di-t-butylpiperidine 992.4 kJ/mol
2,7-Dimethylimidazo(1,2-a)pyridine 1000.4 kJ/mol
2,8,9-Trioxa-1-phosphadamantane 899.1 kJ/mol
2-Aminothiazole 930.5 kJ/mol
2-Azetidinone 852.7 kJ/mol
2-Butanamine 929.7 kJ/mol
2-Butanamine, 2-methyl- 937.6 kJ/mol
2-Butanamine, N-(1-methylpropyl)- 980.7 kJ/mol
2-Butanethiol 813.0 kJ/mol
2-Butanol 815.0 kJ/mol
2-Butanone 827.2 kJ/mol
2-Butanone, 3,3-dimethyl- 840.1 kJ/mol
2-Butanone, 3-methyl- 836.4 kJ/mol
2-Butenal 830.9 kJ/mol
2-Butenal,2-methyl-(Z)- 843.9 kJ/mol
2-butenamide 887.0 kJ/mol
2-Butene, (E)- 746.8 kJ/mol
2-Butene, 2,3-dimethyl- 813.8 kJ/mol
2-Butene, 2-methyl- 808.8 kJ/mol
2-Butenoic acid, 3-methyl- 823.0 kJ/mol
2-Butenoic acid, methyl ester, (E)- 851.4 kJ/mol
2-Butyne 775.7 kJ/mol
2-C6H13(c-C5H4N) 963.6 kJ/mol
2-Cl-4-(CH3)-pyridine 921.3 kJ/mol
2-Cl-6-(CH3)-pyridine 907.9 kJ/mol
2-Cyclohexen-1-one, 3,5,5-trimethyl- 893.7 kJ/mol
2-Cyclohexen-1-one,3-methoxy,5,5-dimethyl- 922.6 kJ/mol
2-Cyclohexenone,3-(N,N-dimethylamino)-5,5-dimethyl- 983.7 kJ/mol
2-Cyclohexenone, 5,5-dimethyl- 869.9 kJ/mol
2-Cyclohexenone,3-amino,5,5-dimethyl- 946.8 kJ/mol
2-Fluoropyridine 884.5 kJ/mol
2H-1,4-Ethanoquinoline, 3,4-dihydro- 979.9 kJ/mol
2H-Azetidin-2-one, 2-methyl- 882.4 kJ/mol
2H-Benzotriazole, 2-methyl- 889.9 kJ/mol
2-Hexyne 806.3 kJ/mol
2H-Pyran, 3,4-dihydro- 865.7 kJ/mol
2H-Pyran, tetrahydro- 823.0 kJ/mol
2H-Thiopyran, tetrahydro- 855.6 kJ/mol
2-Imidazolidinethione 921.7 kJ/mol
2-Me-phenoxy 874.5 kJ/mol
2-Methyl-2H-indazole 941.4 kJ/mol
2-Methylallyl radical 777.8 kJ/mol
2-methylbenzofuran 859.4 kJ/mol
2-Methylenebicyclo[2.2.1]-heptane 860.6 kJ/mol
2-Methylimidazo(1,2-a)pyridine 990.8 kJ/mol
2-Methylthiazole 930.5 kJ/mol
2-Naphthalenol, 3-aminodecahydro-, (2a,3,4aa,8a) 946.8 kJ/mol
2-Norbornanone 847.3 kJ/mol
2-Norbornene 836.4 kJ/mol
2-OH-benzyl 878.6 kJ/mol
2-Pentanone 832.6 kJ/mol
2-pentenal(E) 838.9 kJ/mol
2-Pentene, 2,4-dimethyl- 812.1 kJ/mol
2-Pentene, 2-methyl- 812.1 kJ/mol
2-Pentyne 810.0 kJ/mol
2-Phenyl-2-propyl radical 842.2 kJ/mol
2-Piperidinone, 1-methyl- 924.2 kJ/mol
2-Propanamine 923.8 kJ/mol
2-Propanamine, 2-methyl- 934.3 kJ/mol
2-Propanamine, N-(1-methylethyl)- 971.9 kJ/mol
2-Propanamine, N,N,2-trimethyl- 979.5 kJ/mol
2-Propanamine, N,N-dimethyl- 970.7 kJ/mol
2-Propanamine, N-methyl- 952.3 kJ/mol
2-Propanethiol 803.7 kJ/mol
2-Propanethiol, 2-methyl- 816.3 kJ/mol
2-Propanimine 932.2 kJ/mol
2-Propanone, 1,1,3,3-tetrafluoro- 698.7 kJ/mol
2-Propanone, 1,1,1-trifluoro- 723.8 kJ/mol
2-Propanone, 1-fluoro- 795.4 kJ/mol
2-Propen-1-amine 909.6 kJ/mol
2-Propen-1-amine, 2-methyl- 917.6 kJ/mol
2-Propen-1-amine, N,N-di-2-propenyl- 972.4 kJ/mol
2-Propen-1-amine, N-2-propenyl- 949.3 kJ/mol
2-Propenal 797.1 kJ/mol
2-Propenal, 2-methyl- 808.8 kJ/mol
2-propenamide, N,N,2-trimethyl- 911.7 kJ/mol
2-propenamide, N,N-dimethyl 904.2 kJ/mol
2-Propenenitrile 784.5 kJ/mol
2-Propenoic acid, 2-methyl- 816.7 kJ/mol
2-Propenoic acid, 2-methyl-, methyl ester 831.4 kJ/mol
2-Propenoic acid, methyl ester 825.9 kJ/mol
2-Propyn-1-amine, N,N-dimethyl- 940.1 kJ/mol
2-Propyn-1-amine, N,N-di-2-propynyl- 925.1 kJ/mol
2-Propyn-1-amine, N-2-propynyl- 910.0 kJ/mol
2-Pyridinamine 947.3 kJ/mol
2-Pyridinecarbonitrile 872.8 kJ/mol
2-Pyrrolidinone, 1-methyl- 923.4 kJ/mol
2-Silaisobutene 947.7 kJ/mol
3-(2-(N-methylpyrrolidinyl))pyridine 963.6 kJ/mol
3-(2-pyrrolidinyl)pyridine 964.0 kJ/mol
3(5),4-dimethylpyrazole 927.2 kJ/mol
3(5)-aminopyrazole 921.3 kJ/mol
3(5)-ethyl-5(3)-phenylpyrazole 935.5 kJ/mol
3(5)-methyl-5(3)-t-butylpyrazole 946.0 kJ/mol
3(5)-methyl-5(3)-phenylpyrazole 932.2 kJ/mol
3(5)-methyl-5(3)-ethoxycarbonylpyrazole 902.5 kJ/mol
3(5)-methylpyrazole 905.8 kJ/mol
3(5)-nitropyrazole 820.9 kJ/mol
3(5)-phenyl-5(3)-ethoxycarbonylpyrazole 899.6 kJ/mol
3(5)-phenylpyrazole 914.2 kJ/mol
3(5)-t-butylpyrazole 923.0 kJ/mol
3-(C2H5)-pyridine 947.3 kJ/mol
3-(CF3)-C6H4-CN 791.2 kJ/mol
3-(CF3)-pyridine 892.4 kJ/mol
3-(CH2Cl)-C6H4-CN 811.3 kJ/mol
3-(CH3)2NC6H4C(CH3)=CH2 946.0 kJ/mol
3-(CH3)2NC6H4CN 894.5 kJ/mol
3-(CH3)2NC6H4COCH3 928.0 kJ/mol
3-(CH3)2NC6H4COOCH3 930.1 kJ/mol
3-(CH3SO2)-C6H4-CN 799.6 kJ/mol
3-(NO2)C6H4C(CH3)=CH2 812.1 kJ/mol
3,3,6,9,9-pentamethyl-2,10-diazabicyclo[4.4.0]dec-1-ene 1039.3 kJ/mol
3,4-(CH3)2C6H3-COCH3 882.8 kJ/mol
3,4-(CH3)3-C6H3-CO2CH3 868.6 kJ/mol
3,4,5-(CH3)3-C6H2-CO2CH3 875.3 kJ/mol
3,4,5-Trimethylpyrazole 949.3 kJ/mol
3,4-Cyclobutenopyridine 957.3 kJ/mol
3,4-dimethylfuran 869.0 kJ/mol
3,5-(CF3)2C6H3N(CH3)2 884.9 kJ/mol
3,5-(CH3)=C6H3-COCH3 876.1 kJ/mol
3,5-(CH3)2-C6H3-CCH 850.6 kJ/mol
3,5-(CH3)2-C6H3-COOCH3 864.4 kJ/mol
3,5-diethoxycarbonylpyrazole 881.6 kJ/mol
3,5-diethyl-4-methylpyrazole 952.7 kJ/mol
3,5-dinitropyrazole 759.4 kJ/mol
3,5-diphenylpyrazole 946.4 kJ/mol
3,5-di-t-butyl-4-methylpyrazole 967.3 kJ/mol
3,5-di-t-butylpyrazole 952.7 kJ/mol
3-Amino-1-azabicyclo[2.2.2]octane 985.3 kJ/mol
3-Amino-tricyclo [7.3.0.04,8]dodecan-2-ol 928.0 kJ/mol
3-BrC6H4CH=CH2 822.6 kJ/mol
3-BrC6H4NH2 873.2 kJ/mol
3-Buten-2-one, 3-methyl- 843.1 kJ/mol
3-C2H5C6H4NH2 897.9 kJ/mol
3-CF3C6H4C(CH3)=CH2 823.8 kJ/mol
3-CF3-C6H4-CCH 806.3 kJ/mol
3-CF3C6H4CH=CH2 810.9 kJ/mol
3-CF3-C6H4-COCH3 835.5 kJ/mol
3-CF3-C6H4CON(CH3)2 907.1 kJ/mol
3-CF3-C6H4CONH2 866.9 kJ/mol
3-CF3-C6H4-COOCH3 827.6 kJ/mol
3-CF3C6H4N(CH3)2 908.3 kJ/mol
3-CH3C6H4C(CH3)=CH2 871.1 kJ/mol
3-CH3-C6H4-C(Si(CH3)3)=CH2 868.2 kJ/mol
3-CH3C6H4CHO 840.1 kJ/mol
3-CH3-C6H4CON(CH3)2 927.2 kJ/mol
3-CH3CO-C6H4-COCH3 851.9 kJ/mol
3-CH3OC6H4C(CH3)=CH2 872.8 kJ/mol
3-CH3O-C6H4CON(CH3)2 927.2 kJ/mol
3-CH3O-C6H4-COOCH3 856.9 kJ/mol
3-CH3S-C6H4-COCH3 866.5 kJ/mol
3-CH3S-C6H4-COOCH3 853.5 kJ/mol
3-CH3SC6H4NH2 902.1 kJ/mol
3-CH3SO2-C6H4-COOCH3 830.5 kJ/mol
3-Chloro-1-azabicyclo[2.2.2]octane 954.4 kJ/mol
3-Chloro-5,5-dimethylcyclohex-2-enone 867.8 kJ/mol
3-Chlorobenzamide 877.4 kJ/mol
3-chloro-pyridine-1-oxide 902.1 kJ/mol
3-Cl-4-CH3O-C6H3-CCH 871.9 kJ/mol
3-Cl-4-CH3O-C6H3-COCH3 883.7 kJ/mol
3-Cl-4-CH3O-C6H3-COOCH3 858.6 kJ/mol
3-Cl-4-CH3S-C6H3-CCH 868.6 kJ/mol
3-Cl-4-CH3S-C6H3-COCH3 880.3 kJ/mol
3-Cl-4-CH3S-C6H3-COOCH3 856.5 kJ/mol
3-ClC6H4CCH 812.1 kJ/mol
3-ClC6H4CH=CH2 841.4 kJ/mol
3-Cl-C6H4CON(CH3)2 928.0 kJ/mol
3-Cl-C6H4-COOCH3 835.5 kJ/mol
3-CN-C6H4-COCH3 827.2 kJ/mol
3-CN-C6H4-COOCH3 817.6 kJ/mol
3-F-4-CH3O-C6H3-CCH 871.9 kJ/mol
3-FC6H4C(CH3)=CH2 839.7 kJ/mol
3-FC6H4CCH 808.8 kJ/mol
3-FC6H4CHO 814.2 kJ/mol
3-F-C6H4CON(CH3)2 928.0 kJ/mol
3-F-C6H4-COOCH3 833.0 kJ/mol
3-Fluorobenzyl radical 836.4 kJ/mol
3-fluoro-pyridine-1-oxide 900.0 kJ/mol
3-F-pyridine 902.1 kJ/mol
3-Hexanone 843.1 kJ/mol
3-hexen-2-one(E) 865.7 kJ/mol
3-HO-C6H4-COOCH3 850.2 kJ/mol
3-I-C6H4NH2 878.6 kJ/mol
3-Me-phenoxy 877.4 kJ/mol
3-Methoxy-N,N-dimethylbenzenamine 920.5 kJ/mol
3-methyl-2-butenal 856.9 kJ/mol
3-methyl-3-penten-2-one(Z) 866.5 kJ/mol
3-Methylene-1,5,5-trimethylcyclohexene 905.0 kJ/mol
3-Methylphenylacetylene 843.1 kJ/mol
3-NH2-C6H4CON(CH3)2 944.3 kJ/mol
3-NH2-C6H4CONH2 900.8 kJ/mol
3-Nitroacetophenone 825.9 kJ/mol
3-NO2-C6H4CON(CH3)2 900.8 kJ/mol
3-O2N-C6H4-COOCH3 815.9 kJ/mol
3-OH-benzyl 885.3 kJ/mol
3-Pentanone 836.8 kJ/mol
3-Pentanone, 2,2,4,4-tetramethyl- 861.5 kJ/mol
3-Pentanone, 2,4-dimethyl- 850.2 kJ/mol
3-Penten-2-one 864.4 kJ/mol
3-Penten-2-one, 4-methyl- 878.6 kJ/mol
3-Pyridinamine 954.4 kJ/mol
3-Pyridinecarbonitrile, 1-oxide 879.5 kJ/mol
3-Pyridinecarbonitrile 877.0 kJ/mol
3-Pyridinol 929.7 kJ/mol
3-SO2F-C6H4-COOCH3 806.3 kJ/mol
4-((CH3)3Si)C6H4C(CH3)=CH2 878.6 kJ/mol
4-(1-adamantyl)-pyrazole 912.9 kJ/mol
4-(C2H5)-pyridine 951.0 kJ/mol
4-(C2H5COO)-pyrazole 880.7 kJ/mol
4-(C6H5)-pyrazole 905.8 kJ/mol
4-(CH2Cl)-C6H4-CN 813.0 kJ/mol
4-(CH3)2NC6H4C(CH3)=CH2 964.4 kJ/mol
4-(CH3)2NC6H4COOCH3 920.5 kJ/mol
4-(CH3SO2)-C6H4-CN 798.7 kJ/mol
4-(i-C3H7)-C5H4N 955.6 kJ/mol
4-(n-C8H17)C6H4NH2 894.5 kJ/mol
4-(NO2)C6H4C(CH3)=CH2 815.5 kJ/mol
4,4,4-Trifluorobutylamine 903.3 kJ/mol
4,4-dimethyl-2-imidazoline 988.3 kJ/mol
4-Aminobenzenecarbonal 910.4 kJ/mol
4-BrC6H4CH=CH2 838.9 kJ/mol
4-Bromopyridine 918.0 kJ/mol
4-CF3C6H4C(CH3)CH2 825.5 kJ/mol
4-CF3-C6H4-COCH3 836.8 kJ/mol
4-CF3-C6H4CONH2 862.7 kJ/mol
4-CF3-C6H4-COOCH3 826.8 kJ/mol
4-CF3C6H4N(CH3)2 903.3 kJ/mol
4-CH3C6H4C(CH3)CH2 882.0 kJ/mol
4-CH3-C6H4-C(Si(CH3)3)=CH2 877.0 kJ/mol
4-CH3COO-C6H4-COCH3 853.1 kJ/mol
4-CH3OC6H4C(CH3)=CH2 911.3 kJ/mol
4-CH3O-C6H4-C(Si(CH3)3)=CH2 902.9 kJ/mol
4-CH3O-C6H4-CCH 886.6 kJ/mol
4-CH3SC6H4C(CH3)=CH2 946.0 kJ/mol
4-CH3S-C6H4-CCH 886.6 kJ/mol
4-CH3S-C6H4-COCH3 888.3 kJ/mol
4-CH3S-C6H4-COOCH3 864.4 kJ/mol
4-CH3SO2-C6H4-COOCH3 827.6 kJ/mol
4-Chloro-1-azabicyclo[2.2.2]octane 949.3 kJ/mol
4-Chlorobenzoic acid methyl ester 842.2 kJ/mol
4-Chloropyridine 916.3 kJ/mol
4-ClC6H4C(CH3)=CH2 854.4 kJ/mol
4-ClC6H4N(C2H5)2 930.9 kJ/mol
4-Cl-pyrazole 868.6 kJ/mol
4-Cyanobenzoic acid methyl ester 816.7 kJ/mol
4-Cyanopiperidine 912.1 kJ/mol
4-Ethylcamphor 865.3 kJ/mol
4-ethynyl-pyridine 930.1 kJ/mol
4-FC6H4C(CH3)=CH2 862.7 kJ/mol
4-F-C6H4-C(Si(CH3)3)=CH2 858.1 kJ/mol
4-FC6H4CCH 827.6 kJ/mol
4-F-C6H4-COOCH3 841.4 kJ/mol
4-fluoropyrazole 863.2 kJ/mol
4-F-phenoxy 854.4 kJ/mol
4-F-pyridine 912.9 kJ/mol
4-H2NC6H4C(CH3)=CH2 929.7 kJ/mol
4-H2N-C6H4-CCH 912.5 kJ/mol
4-HC(O)-C6H4-COOCH3 833.0 kJ/mol
4-Heptanone 845.2 kJ/mol
4H-Pyran-4-one, 2,6-dimethyl- 941.4 kJ/mol
4-Hydroxy-4-methylpentan-2-one 823.0 kJ/mol
4-Me-phenoxy 884.5 kJ/mol
4-Methyl-2,3-dihydrofuran 868.6 kJ/mol
4-Methyl-2,6,7-trioxa-1-phosphabicyclo[2.2.1]heptane 823.8 kJ/mol
4-Methyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane 882.8 kJ/mol
4-Methylcamphor 863.2 kJ/mol
4-Methylene-2,5-cyclohexadiene-1-one 923.8 kJ/mol
4-Methylimidazole 952.7 kJ/mol
4-methylpyrazole 906.7 kJ/mol
4-N,N-Dimethylaminoacetophenone 932.6 kJ/mol
4-NH2-C6H4CON(CH3)2 956.9 kJ/mol
4-NH2-pyrazole 907.5 kJ/mol
4-Nitrobenzoic acid methyl ester 813.4 kJ/mol
4-Nitropyridine 874.5 kJ/mol
4-NO2-C6H4CH2OH 810.4 kJ/mol
4-NO2-pyrazole 822.2 kJ/mol
4-OH-benzyl 896.6 kJ/mol
4-phenyl-pyridine 939.7 kJ/mol
4-Pyridinamine 979.9 kJ/mol
4-Pyridinamine, N,N-dimethyl- 997.5 kJ/mol
4-Pyridinecarbonitrile, 1-oxide 873.2 kJ/mol
4-Pyridinecarbonitrile 880.7 kJ/mol
4-Pyridinecarboxaldehyde 904.6 kJ/mol
4-SO2F-C6H4-COOCH3 802.5 kJ/mol
4-Tert-butylbenzoic acid methyl ester 866.9 kJ/mol
4-Trifluoromethylbenzoic acid nitrile 787.0 kJ/mol
4-Trifluoromethylpiperidine 925.1 kJ/mol
5,5-Dimethyl-3-(diethylamino)-cyclohex-2-en-1-one 1001.2 kJ/mol
5,5-Dimethyl-3-(piperidino)cyclohex-2-en-1-one 1000.8 kJ/mol
5,5-Dimethyl-3-pyrrolidino-cyclohex-2-en-1-one 1001.2 kJ/mol
5,6-Dihydrouridine 874.0 kJ/mol
5-amino-tricyclo[4.4.0.03,8]decan-4-ol 928.4 kJ/mol
5H-1-Pyrindine, 6,7-dihydro- 957.3 kJ/mol
5H-2-Pyrindine, 6,7-dihydro- 962.3 kJ/mol
5-Methylimidazo(1,2-a)pyridine 987.4 kJ/mol
5-Nonanone 853.5 kJ/mol
6-Chloro-1-methyl-2(1H)pyridinone 918.4 kJ/mol
6-Chloropurine 873.6 kJ/mol
6H-Purin-6-one, 2-amino-1,7-dihydro- 959.4 kJ/mol
7-ethyl-1,5,7-triazabicyclo[4.4.0]dec-5-ene (ETBD) 1068.2 kJ/mol
7-isopropyl-1,5,7-triazabicyclo[4.4.0]dec-5-ene (ITBD) 1071.5 kJ/mol
7-methyl-1,5,7-triazabicyclo[4.4.0]dec-5-ene 1062.7 kJ/mol
7-Methylimidazo(1,2-a)pyridine 994.5 kJ/mol
7-Oxabicyclo[2.2.1]heptane 844.3 kJ/mol
9,5-metheno-5H,7H-pyrimido[1,6-a:3,4-a']bisazepine 930.9 kJ/mol
9H-Purine 920.1 kJ/mol
Acenaphthene 851.9 kJ/mol
Acetaldehyde 768.6 kJ/mol
Acetaldehyde, trichloro- 722.2 kJ/mol
Acetaldimine 884.9 kJ/mol
Acetamide 863.6 kJ/mol
Acetamide, N,N-dimethyl- 907.9 kJ/mol
Acetamide, N,N-diethyl- 925.5 kJ/mol
Acetamide, N-ethyl- 897.9 kJ/mol
Acetamide, N-hydroxy-N-methyl 876.1 kJ/mol
Acetamide, N-methyl- 888.7 kJ/mol
Acetamide, N-methoxy 879.1 kJ/mol
Acetamide,N-hydroxy 854.0 kJ/mol
Acetic acid 783.7 kJ/mol
Acetic acid ethenyl ester 813.8 kJ/mol
Acetic acid, 1-methylethyl ester 836.8 kJ/mol
Acetic acid, chloro- 765.3 kJ/mol
Acetic acid, fluoro- 765.3 kJ/mol
Acetic acid, methyl ester 821.7 kJ/mol
Acetic acid, trichloro- 769.9 kJ/mol
Acetic acid, trichloro-, ethyl ester 790.4 kJ/mol
Acetic acid, trifluoro- 711.7 kJ/mol
Acetic acid, trifluoro-, ethyl ester 759.0 kJ/mol
Acetone 812.1 kJ/mol
Acetonitrile 779.1 kJ/mol
Acetonitrile, (dimethylamino)- 884.5 kJ/mol
Acetonitrile, chloro- 745.6 kJ/mol
Acetonitrile, trichloro- 723.0 kJ/mol
Acetophenone 861.1 kJ/mol
Acetophenone, 3'-chloro- 846.8 kJ/mol
Acetophenone, 4'-methoxy- 895.8 kJ/mol
Acetophenone, 4'-nitro- 824.2 kJ/mol
Acetophenone, 4'-amino- 908.8 kJ/mol
Acetophenone, 4'-hydroxy- 883.7 kJ/mol
Acetylacetone 873.6 kJ/mol
Acetylpyrrolidine 925.5 kJ/mol
Acridine 972.8 kJ/mol
Acrylamide 870.7 kJ/mol
Adamantylmethylether 860.2 kJ/mol
Adenine 942.7 kJ/mol
adenosine 989.1 kJ/mol
Alanine 901.7 kJ/mol
Allyl radical 736.0 kJ/mol
a-Methylstyrene 864.0 kJ/mol
Amino radical 773.2 kJ/mol
Ammonia 853.5 kJ/mol
Aniline 882.4 kJ/mol
Aniline, N-methyl- 916.7 kJ/mol
Anilino radical 949.8 kJ/mol
Anthracene 877.4 kJ/mol
Anthracene, 1,2,3,4,5,6,7,8-octahydro- 845.6 kJ/mol
Anthracene, 2-methyl- 887.4 kJ/mol
Anthracene, 9-methyl- 896.6 kJ/mol
Anthranilic acid 901.7 kJ/mol
Arsabenzene 784.9 kJ/mol
Arsine 748.1 kJ/mol
Arsine, trimethyl- 897.5 kJ/mol
Arsine, triphenyl- 908.8 kJ/mol
Aspartic acid 908.8 kJ/mol
Azetidine 943.5 kJ/mol
Azetidine, N-methyl- 882.4 kJ/mol
Aziridine, 1-methyl- 934.7 kJ/mol
Aziridine, 1-phenyl- 926.3 kJ/mol
Aziridine, 2-methyl- 925.1 kJ/mol
Azulene 925.1 kJ/mol
Azulene, 1,4-dimethyl-7-(1-methylethyl)- 983.2 kJ/mol
B(OH)3 728.0 kJ/mol
B5H8 763.6 kJ/mol
Barium monoxide 1215.5 kJ/mol
B-Borazinyl radical 802.9 kJ/mol
Benzaldehyde 833.9 kJ/mol
Benzaldehyde, 3-chloro- 813.0 kJ/mol
Benzaldehyde, 3-methoxy- 843.9 kJ/mol
Benzaldehyde, 4-(dimethylamino)- 924.7 kJ/mol
Benzaldehyde, 4-chloro- 831.4 kJ/mol
Benzaldehyde, 4-nitro- 795.0 kJ/mol
Benzaldehyde, 4-methoxy- 881.2 kJ/mol
Benzaldehyde, 4-methyl- 851.9 kJ/mol
Benzaldehyde, 4-fluoro- 827.2 kJ/mol
Benzamide 892.0 kJ/mol
Benzamide, 3-fluoro- 877.4 kJ/mol
Benzamide, 3-nitro- 854.4 kJ/mol
Benzamide, 4-amino- 928.0 kJ/mol
Benzamide, 4-chloro- 877.4 kJ/mol
Benzamide, 4-methyl- 900.8 kJ/mol
Benzamide, 4-nitro- 845.2 kJ/mol
Benzamide, N,N-dimethyl- 932.6 kJ/mol
Benzamide, N,N-dimethyl-4-nitro- 900.8 kJ/mol
Benzenamine, 2,6-dimethyl- 901.7 kJ/mol
Benzenamine, 2-methyl- 890.8 kJ/mol
Benzenamine, 2-methoxy- 905.0 kJ/mol
Benzenamine, 3-(trifluoromethyl)- 856.9 kJ/mol
Benzenamine, 3-fluoro- 867.3 kJ/mol
Benzenamine, 3-methyl- 895.8 kJ/mol
Benzenamine, 3-methoxy- 912.9 kJ/mol
Benzenamine, 4-chloro-N,N-dimethyl- 923.0 kJ/mol
Benzenamine, 4-methoxy- 900.4 kJ/mol
Benzenamine, 4-methoxy-N,N-dimethyl- 948.9 kJ/mol
Benzenamine, N,N,2,6-tetramethyl- 954.0 kJ/mol
Benzenamine, N,N,3,5-tetramethyl- 956.0 kJ/mol
Benzenamine, N,N,2-trimethyl- 951.9 kJ/mol
Benzenamine, N,N,3-trimethyl- 942.2 kJ/mol
Benzenamine, N,N,4-trimethyl- 950.2 kJ/mol
Benzenamine, N,N-diphenyl- 908.8 kJ/mol
Benzenamine, N,N-dimethyl-3-nitro- 894.1 kJ/mol
Benzenamine, N,N-diethyl-3-methyl- 964.0 kJ/mol
Benzenamine, N,N-dimethyl- 941.0 kJ/mol
Benzenamine, N,N-diethyl- 959.8 kJ/mol
Benzenamine, N,N-diethyl-4-methyl- 962.7 kJ/mol
Benzenamine, N,N-dimethyl-4-nitro- 896.6 kJ/mol
Benzenamine, N-ethyl- 924.7 kJ/mol
Benzenamine, N-methyl-4-nitro- 891.6 kJ/mol
Benzene 750.2 kJ/mol
Benzene, (1-methylethyl)- 791.6 kJ/mol
Benzene, (2,2-dimethyl-1-methylenepropyl)- 859.4 kJ/mol
Benzene, (methoxymethyl)- 816.7 kJ/mol
Benzene, (methylthio)- 872.8 kJ/mol
Benzene, 1-(2,2-dimethyl-1-methylenepropyl)-3-(trifluoromethyl)- 830.9 kJ/mol
Benzene, 1-(2,2-dimethyl-1-methylenepropyl)-4-methoxy- 897.9 kJ/mol
Benzene, 1-(2,2-dimethyl-1-methylenepropyl)-4-methyl- 874.5 kJ/mol
Benzene, 1-(2,2-dimethyl-1-methylenepropyl)-3-methyl- 867.3 kJ/mol
Benzene, 1-(2,2-dimethyl-1-methylenepropyl)-3-fluoro- 838.9 kJ/mol
Benzene, 1-(2,2-dimethyl-1-methylenepropyl)-3,5-dimethyl- 874.5 kJ/mol
Benzene, 1-(2,2-dimethyl-1-methylenepropyl)-4-(methylthio)- 895.0 kJ/mol
Benzene, 1,1'-(1,3-propanediyl)bis- 820.1 kJ/mol
Benzene, 1,1'-(1,4-butanediyl)bis- 822.2 kJ/mol
Benzene, 1,1'-ethenylidenebis-[4-methyl- 900.4 kJ/mol
Benzene, 1,2,3,4-tetrafluoro- 700.4 kJ/mol
Benzene, 1,2,3,5-tetrafluoro- 747.3 kJ/mol
Benzene, 1,2,3,5-tetramethyl- 845.6 kJ/mol
Benzene, 1,2,4,5-tetrafluoro- 746.4 kJ/mol
Benzene, 1,2-difluoro- 731.4 kJ/mol
Benzene, 1,2-dimethyl- 795.8 kJ/mol
Benzene, 1,3,5-tri-tert-butyl- 848.9 kJ/mol
Benzene, 1,3,5-trimethyl- 836.4 kJ/mol
Benzene, 1,3,5-trimethyl-2-nitro- 823.8 kJ/mol
Benzene, 1,3-difluoro- 749.8 kJ/mol
Benzene, 1,3-dimethyl- 812.1 kJ/mol
Benzene, 1,4-difluoro- 718.8 kJ/mol
Benzene, 1-bromo-4-methyl- 775.3 kJ/mol
Benzene, 1-bromo-3-methyl- 782.0 kJ/mol
Benzene, 1-bromo-2-methyl- 775.3 kJ/mol
Benzene, 1-chloro-2-methyl- 790.4 kJ/mol
Benzene, 1-chloro-3-(2,2-dimethyl-1-methylenepropyl)- 839.7 kJ/mol
Benzene, 1-chloro-3-methyl- 784.1 kJ/mol
Benzene, 1-chloro-4-ethynyl- 832.2 kJ/mol
Benzene, 1-chloro-4-methyl- 762.7 kJ/mol
Benzene, 1-cyclopropyl-4-methyl- 846.4 kJ/mol
Benzene, 1-cyclopropyl-3-methyl- 836.0 kJ/mol
Benzene, 1-ethenyl-4-methyl- 861.9 kJ/mol
Benzene, 1-ethenyl-3-methyl- 849.4 kJ/mol
Benzene, 1-ethenyl-2-methyl- 855.2 kJ/mol
Benzene, 1-ethynyl-4-methyl- 853.1 kJ/mol
Benzene, 1-fluoro-2-methyl- 773.2 kJ/mol
Benzene, 1-fluoro-3-methyl- 785.3 kJ/mol
Benzene, 1-fluoro-4-methyl- 764.0 kJ/mol
Benzene, 1-iodo-2-methyl- 780.3 kJ/mol
Benzene, 1-methyl-2-(1-methylethenyl)- 857.7 kJ/mol
Benzene, 1-methyl-3-(1-methylethenyl)- 867.8 kJ/mol
Benzene, 1-methyl-4-nitro- 815.0 kJ/mol
Benzene, 1-propenyl-, (E)- 834.3 kJ/mol
Benzene, 2,4-dimethyl-1-nitro- 830.9 kJ/mol
Benzene, 2-chloro-4-(2,2-dimethyl-1-methylenepropyl)-1-methoxy- 882.8 kJ/mol
Benzene, azido- 820.1 kJ/mol
Benzene, bromo- 754.0 kJ/mol
Benzene, butyl- 792.0 kJ/mol
Benzene, chloro- 753.1 kJ/mol
Benzene, cyclopropyl- 834.7 kJ/mol
Benzene, fluoro- 756.0 kJ/mol
Benzene, hexamethyl- 860.6 kJ/mol
Benzene, isocyano- 868.6 kJ/mol
Benzene, methoxy- 839.7 kJ/mol
Benzene, nitro- 800.4 kJ/mol
Benzene, nitroso- 854.4 kJ/mol
Benzene, pentamethyl- 850.6 kJ/mol
Benzene, propyl- 789.9 kJ/mol
Benzene,1-methyl-3-(2-phenylethyl)- 833.5 kJ/mol
Benzeneacetonitrile 805.4 kJ/mol
Benzeneethanamine 936.4 kJ/mol
Benzenemethanamine, N,N-dimethyl- 968.6 kJ/mol
Benzo[ghi]perylene 876.1 kJ/mol
Benzoic acid 820.9 kJ/mol
Benzoic acid, 2-methyl- 838.9 kJ/mol
Benzoic acid, 2-methyl-, methyl ester 858.1 kJ/mol
Benzoic acid, 3-amino- 864.8 kJ/mol
Benzoic acid, 3-methyl- 829.7 kJ/mol
Benzoic acid, 3-methyl-, methyl ester 857.7 kJ/mol
Benzoic acid, 4-hydroxy-, methyl ester 863.6 kJ/mol
Benzoic acid, 4-amino-, methyl ester 884.1 kJ/mol
Benzoic acid, 4-methyl- 836.8 kJ/mol
Benzoic acid, 4-methyl-, methyl ester 861.5 kJ/mol
Benzoic acid, 4-methoxy-, methyl ester 870.7 kJ/mol
Benzoic acid, methyl ester 850.6 kJ/mol
Benzonitrile 811.7 kJ/mol
Benzonitrile, 3-amino- 842.2 kJ/mol
Benzonitrile, 3-nitro- 781.6 kJ/mol
Benzonitrile, 4-acetyl- 826.8 kJ/mol
Benzonitrile, 4-(dimethylamino)- 889.1 kJ/mol
Benzonitrile, 4-formyl- 797.1 kJ/mol
Benzonitrile, 4-nitro- 775.7 kJ/mol
Benzophenone 882.4 kJ/mol
Benzoxazole 891.6 kJ/mol
Benzyl alcohol 778.2 kJ/mol
Benzyl methyl ketone 842.7 kJ/mol
Benzyl radical 831.4 kJ/mol
Benzylamine 913.4 kJ/mol
Benzyne 841.0 kJ/mol
Bibenzyl 801.7 kJ/mol
Bicyclo[2.2.1]hept-2-en-5-one 845.2 kJ/mol
Bicyclo[2.2.1]hept-2-ene, 7-oxa- 837.2 kJ/mol
Bicyclo[2.2.1]hept-2-en-7-one 830.1 kJ/mol
Bicyclo[2.2.1]hept-2-ene, 2-methyl- 845.2 kJ/mol
Biphenyl 813.8 kJ/mol
Biphenylene 848.1 kJ/mol
Borazine 802.5 kJ/mol
Boric acid, trimethyl ester 815.9 kJ/mol
Boron oxide hydroxide 763.2 kJ/mol
Butanal 792.9 kJ/mol
Butane, 1-methoxy- 820.5 kJ/mol
Butanenitrile 798.3 kJ/mol
Butanoic acid, methyl ester 836.4 kJ/mol
Butenamide, N,N-dimethyl- 930.1 kJ/mol
Butyltrimethylhydrazine 970.7 kJ/mol
C2H5CH(OC2H5)CH2CN 807.1 kJ/mol
C2H5OCH=CHCH3 876.5 kJ/mol
C2H5OCOOCH3 842.7 kJ/mol
C2H5S(OCH3)CO 833.9 kJ/mol
C2S 869.4 kJ/mol
C3S 933.0 kJ/mol
C6H11CH2OCH3 833.5 kJ/mol
C6H5(CHC2H5) radical 842.2 kJ/mol
C6H5CD3 789.5 kJ/mol
C6H5CH=NH 911.7 kJ/mol
C6H5COCCl3 818.8 kJ/mol
Calcium monoxide 1190.8 kJ/mol
Camphor 859.4 kJ/mol
Carbon diselenide 725.1 kJ/mol
Carbon monoselenide 831.8 kJ/mol
Carbon monosulfide 791.6 kJ/mol
Carbon trimer 766.9 kJ/mol
Carbonic acid, dimethyl ester 830.1 kJ/mol
Carbonochloridic acid, ethyl ester 764.8 kJ/mol
Carbonodithioic acid, o,s-dimethyl ester 862.7 kJ/mol
Carbonothioic dichloride 752.7 kJ/mol
c-C(CH3)(C2H5)NHNH 903.7 kJ/mol
c-C4H6N(2-OCH3) 957.7 kJ/mol
c-C5H10N(2-OCH3) 969.9 kJ/mol
c-C5H9N,2-CH2Cl,1-CH3 964.8 kJ/mol
c-C6H11CH2N(CH3)2 975.7 kJ/mol
c-C6H11CH2NH2 926.8 kJ/mol
c-C6H11CH2SH 813.8 kJ/mol
c-C6H11COCH3 841.4 kJ/mol
c-C6H11COOCH3 846.0 kJ/mol
c-C6H11SCH3 864.4 kJ/mol
CCCO 880.3 kJ/mol
CCl3CH2N(CH3)2 912.9 kJ/mol
CCl3COCH3 768.2 kJ/mol
Cesium hydroxide 1118.0 kJ/mol
CF2HCON(CH3)2 864.0 kJ/mol
CF3C(O)OCH3 740.6 kJ/mol
CF3CH2COOC2H5 797.5 kJ/mol
CF3CH2NHCH3 881.2 kJ/mol
CF3CH2SC2H5 797.5 kJ/mol
CF3CO2(n-C3H7) 764.0 kJ/mol
CF3CO2(n-C4H9) 764.8 kJ/mol
CF3CON(CH3)2 848.9 kJ/mol
CF3CONH(n-C4H9) 850.2 kJ/mol
CF3COOCH2CH2F 735.5 kJ/mol
CF3COSCH3 765.3 kJ/mol
CF3OCH3 719.2 kJ/mol
CF3SO3H 699.6 kJ/mol
CFH2COCFH2 762.7 kJ/mol
CH2=(CH3)OSi(CH3)3 930.5 kJ/mol
CH2=C(CH3)-SCH3 888.7 kJ/mol
CH2=C(CH3)-SeCH3 879.5 kJ/mol
CH2=C(SeCH3)2 921.3 kJ/mol
CH2=CH-SeCH3 851.0 kJ/mol
CH2CH2CH2OH 736.0 kJ/mol
CH2CH2OH 745.2 kJ/mol
CH2CHO 774.0 kJ/mol
CH2COCH3 820.1 kJ/mol
CH2NH2 832.6 kJ/mol
CH3(C6H5)2PO 908.8 kJ/mol
CH3C(=NH)NH2 970.7 kJ/mol
CH3C(=S)OCH3 846.0 kJ/mol
CH3C(N(CH3)2)=NN(CH3)2 995.8 kJ/mol
CH3C(OCH3)=CHCOOCH3 916.7 kJ/mol
CH3-CC-CC-CH2 819.2 kJ/mol
CH3CH=C(CH3)C2H5 813.0 kJ/mol
CH3CH=C(CH3)CH=CH2 852.3 kJ/mol
CH3CH=CHN(CH3)2 966.9 kJ/mol
CH3CH2NNN 877.8 kJ/mol
CH3COCH2CH2COCH3 892.0 kJ/mol
CH3COCN 746.8 kJ/mol
CH3CONHCH(CH3)COOCH3 938.5 kJ/mol
CH3CONHCH2COOCH3 892.0 kJ/mol
CH3COOCN 745.6 kJ/mol
CH3NCCCO 920.1 kJ/mol
CH3NHCH2CH2NHCH3 989.1 kJ/mol
CH3NHCH2CN 864.0 kJ/mol
CH3NHCOOC2H5 888.7 kJ/mol
CH3O(CH2)4OCH3 931.4 kJ/mol
CH3O(CH2)5OCH3 931.4 kJ/mol
CH3O[CH2CH2O]4CH3 954.0 kJ/mol
CH3OC(S)N(CH3)2 900.0 kJ/mol
CH3SCH2CN 784.9 kJ/mol
CH3SO3H 761.5 kJ/mol
c-hexane-1,2-dione 849.8 kJ/mol
Chlorofluoromethylene 772.4 kJ/mol
Chloromethylene 874.0 kJ/mol
Chromium 791.2 kJ/mol
Chromium hexacarbonyl 739.3 kJ/mol
Chromium,dicarbonyl(?5-2,4-cyclopentadien-1-yl)nitrosyl- 819.2 kJ/mol
Chrysene 841.0 kJ/mol
Cinnoline 936.4 kJ/mol
cis-1,2-Cyclopentanediol 885.8 kJ/mol
cis-1,3-cyclohexandiol 882.4 kJ/mol
cis-3-Aminobicyclo[2.2.2]octan-2-ol 948.5 kJ/mol
Cl(CH2)2CN 773.2 kJ/mol
ClCON(CH3)2 846.0 kJ/mol
Cobalt 742.7 kJ/mol
CoCH2 937.6 kJ/mol
c-OP{N(CH3)2}N(CH3)CH2CH2N(CH3) 961.9 kJ/mol
Coronene 861.5 kJ/mol
c-P(O)CH3N(CH3)CH2CH2N(CH3) 947.7 kJ/mol
Crotonic acid 823.8 kJ/mol
CTe 892.0 kJ/mol
CTe2 771.1 kJ/mol
Cubane 859.8 kJ/mol
Cyanamide 805.4 kJ/mol
Cyanamide, dimethyl- 852.3 kJ/mol
Cyanogen bromide 749.8 kJ/mol
Cyanogen chloride 722.2 kJ/mol
Cyanoketene 784.1 kJ/mol
Cyclobutane carboxylic acid 817.6 kJ/mol
Cyclobutanone 802.5 kJ/mol
Cyclobutene 784.5 kJ/mol
Cyclobutene, 1,2-dimethyl- 838.1 kJ/mol
Cyclobutene, 1-methyl- 841.4 kJ/mol
Cycloheptanone 845.6 kJ/mol
Cycloheptatrienyl radical 832.2 kJ/mol
Cyclohexanamine 934.3 kJ/mol
Cyclohexanamine, N,N-dimethyl- 983.7 kJ/mol
Cyclohexanecarboxylic acid 823.8 kJ/mol
Cyclohexanecarbonitrile 815.0 kJ/mol
Cyclohexanemethanol 802.1 kJ/mol
Cyclohexanone 841.0 kJ/mol
Cyclohexanone, 4-methyl- 844.7 kJ/mol
Cyclohexene 784.5 kJ/mol
Cyclohexene oxide 848.1 kJ/mol
Cyclohexene, 1-methyl- 825.1 kJ/mol
Cyclononanone 852.7 kJ/mol
Cyclooctanone 849.4 kJ/mol
Cyclopentadienyl radical 831.4 kJ/mol
cyclopentane carboxylic acid 817.6 kJ/mol
Cyclopentane, methylene- 832.2 kJ/mol
Cyclopentanone 823.8 kJ/mol
Cyclopentene 766.5 kJ/mol
Cyclopentene, 1-methyl- 816.3 kJ/mol
Cyclopentene, 1,2-dimethyl- 822.6 kJ/mol
Cyclopropane 750.2 kJ/mol
Cyclopropane, (1-methylethenyl)- 871.5 kJ/mol
Cyclopropane, 1-ethenyl-1-methyl- 855.6 kJ/mol
Cyclopropane, 1,1'-ethenylidenebis- 904.6 kJ/mol
Cyclopropanecarbonitrile 808.3 kJ/mol
Cyclopropanecarboxylic acid 821.3 kJ/mol
Cyclopropanecarboxylic acid, methyl ester 842.2 kJ/mol
Cyclopropene 818.4 kJ/mol
Cyclopropene, 3,3-dimethyl- 847.7 kJ/mol
Cyclopropenyl radical 734.3 kJ/mol
Cyclopropenylidene 951.0 kJ/mol
Cyclopropyl radical 738.9 kJ/mol
Cyclopropylamine 904.6 kJ/mol
Cytidine 982.4 kJ/mol
Deoxyadenosine 991.6 kJ/mol
Deoxycytidine 988.3 kJ/mol
Deoxyguanosine 995.4 kJ/mol
Di(1-pyrazolyl)methane 924.7 kJ/mol
Dicarbon monoxide 774.9 kJ/mol
Dicesium monoxide 1443.1 kJ/mol
Dichloromethylene 861.1 kJ/mol
Diethanolamine 953.1 kJ/mol
Diethyl sulfide 856.9 kJ/mol
Difluoroethanol 727.6 kJ/mol
Difluoromethylene 764.8 kJ/mol
Diimide 802.9 kJ/mol
Diisopropyl ether 855.6 kJ/mol
Diisopropyl sulfide 876.5 kJ/mol
Dilithium monoxide 1205.8 kJ/mol
Dimethyl ether 792.0 kJ/mol
Dimethyl sulfide 830.9 kJ/mol
Dimethyl sulfoxide 884.5 kJ/mol
Dimethyl thioacetamide 925.5 kJ/mol
Dimethyl(2,2-difluoroethyl)amine 902.9 kJ/mol
Dimethyl(trimethylsilylmethyl)amine 974.5 kJ/mol
Dimethylphenylphosphine 969.0 kJ/mol
Di-n-butyl sulfide 871.9 kJ/mol
Di-n-propyl ether 838.1 kJ/mol
Diphenylmethane 802.1 kJ/mol
Dipotassium oxide 1342.6 kJ/mol
Di-sec-butyl ether 866.1 kJ/mol
Disiloxane 748.9 kJ/mol
Disiloxane, hexamethyl- 846.4 kJ/mol
Disodium 1146.8 kJ/mol
Disodium oxide 1375.7 kJ/mol
Disulfide, dimethyl 815.5 kJ/mol
Di-tert-butyl ether 887.4 kJ/mol
Di-tert-butyl sulfide 893.7 kJ/mol
Dithiouracil 911.3 kJ/mol
dodecahedrane 843.9 kJ/mol
Endo-2-aminonorbornane 935.1 kJ/mol
Ethanamine, 2-methoxy- 928.4 kJ/mol
Ethanamine, N-(2-propylidene) 973.2 kJ/mol
Ethanamine, N,N-dimethyl- 960.2 kJ/mol
Ethanamine, N-butylidene- 955.6 kJ/mol
Ethanamine, N-ethyl-N-methyl- 971.1 kJ/mol
Ethanamine, N-ethyl- 952.3 kJ/mol
Ethanamine, N-ethyl-N-hydroxy- 914.6 kJ/mol
Ethanamine, N-ethylidene 941.8 kJ/mol
Ethanamine, N-methyl- 942.2 kJ/mol
Ethane, (methylthio)- 846.4 kJ/mol
Ethane, 1,1'-oxybis[2-methoxy- 918.8 kJ/mol
Ethane, 1,2-dimethoxy- 858.1 kJ/mol
Ethane, isocyano- 851.4 kJ/mol
Ethane, methoxy- 808.8 kJ/mol
Ethane, nitro- 765.7 kJ/mol
Ethanethioamide 884.5 kJ/mol
Ethanethioic acid, s-methyl ester 828.9 kJ/mol
Ethanethiol 789.5 kJ/mol
Ethanol 776.6 kJ/mol
Ethanol, 1,1-dimethyl- 802.5 kJ/mol
Ethanol, 2,2,2-trichloro- 729.3 kJ/mol
Ethanol, 2,2,2-trifluoro- 700.4 kJ/mol
Ethanol, 2-bromo- 766.1 kJ/mol
Ethanol, 2-chloro- 766.1 kJ/mol
Ethanol, 2-fluoro- 715.5 kJ/mol
Ethanol, 2-methoxy- 768.6 kJ/mol
Ethanolamine 930.1 kJ/mol
Ethanone, 1-(3-fluorophenyl)- 845.6 kJ/mol
Ethanone, 1-(3-hydroxyphenyl)- 863.6 kJ/mol
Ethanone, 1-(3-methoxyphenyl)- 871.1 kJ/mol
Ethanone, 1-(3-methylphenyl)- 868.2 kJ/mol
Ethanone, 1-(3-pyridinyl)- 916.3 kJ/mol
Ethanone, 1-(4-chlorophenyl)- 856.5 kJ/mol
Ethanone, 1-(4-fluorophenyl)- 858.6 kJ/mol
Ethanone, 1-(4-methylphenyl)- 875.3 kJ/mol
Ethanone, 1-(4-pyridinyl)- 914.6 kJ/mol
Ethanone, 1,1'-(1,4-phenylene)bis- 850.6 kJ/mol
Ethanone, 1-[4-(1,1-dimethylethyl)phenyl]- 882.4 kJ/mol
Ethanone, 1-cyclopropyl- 854.8 kJ/mol
Ethanone, 2,2,2-trifluoro-1-phenyl- 799.1 kJ/mol
Ethenamine 898.7 kJ/mol
Ethene, 1,1-difluoro- 733.9 kJ/mol
Ethene, 1,1-dimethoxy- 956.9 kJ/mol
Ethene, ethoxy- 870.3 kJ/mol
Ethene, fluoro- 728.9 kJ/mol
Ethene, methoxy- 859.4 kJ/mol
Ethene, trifluoro- 699.6 kJ/mol
Ethenylcyclopropane 816.3 kJ/mol
Ether, ethyl 2,2,2-trifluoroethyl 762.3 kJ/mol
Ethoxy ethane 828.4 kJ/mol
Ethyl acetate 835.5 kJ/mol
Ethyl radical, 1-hydroxy 720.1 kJ/mol
Ethylamine 912.1 kJ/mol
Ethylamine, 2,2-difluoro- 870.7 kJ/mol
Ethylamine, 2-fluoro- 892.0 kJ/mol
Ethylbenzene 787.8 kJ/mol
Ethylene carbonate 814.2 kJ/mol
Ethylene oxide 774.0 kJ/mol
Ethylene, 1,1-diphenyl- 885.8 kJ/mol
Ethylenediamine 951.4 kJ/mol
Ethylenimine 905.4 kJ/mol
Ethynyl radical 753.1 kJ/mol
Exo-2-aminonorbornane 935.1 kJ/mol
F(CH3)Si=CH2 771.1 kJ/mol
F2Si=CH2 742.2 kJ/mol
FCH2CH2CH2NH2 920.9 kJ/mol
FCO2C2H5 756.9 kJ/mol
Ferrocene 863.6 kJ/mol
Fluoranthene 828.4 kJ/mol
Fluorene 831.4 kJ/mol
Fluoromethylene 797.9 kJ/mol
Formaldehyde 713.0 kJ/mol
Formaldehyde, seleno- 764.0 kJ/mol
Formamide 822.2 kJ/mol
Formamide, N,N-dimethyl- 887.4 kJ/mol
Formamide, N-methyl- 851.4 kJ/mol
Formic acid 741.8 kJ/mol
Formic acid, 1-methylethyl ester 811.3 kJ/mol
Formic acid, butyl ester 805.8 kJ/mol
Formic acid, ethyl ester 799.6 kJ/mol
Formic acid, propyl ester 805.0 kJ/mol
Fulminic acid 758.1 kJ/mol
Furan 803.3 kJ/mol
Furan, 2,3-dihydro-5-methyl- 910.4 kJ/mol
Furan, 2,3-dihydro- 866.9 kJ/mol
Furan, 2,5-bis(1,1-dimethylethyl)- 894.5 kJ/mol
Furan, 2,5-dihydro- 823.4 kJ/mol
Furan, 2,5-dimethyl- 866.1 kJ/mol
Furan, 2-methyl- 866.1 kJ/mol
Furan, 3-methyl- 854.0 kJ/mol
Furan, tetrahydro- 822.2 kJ/mol
Furan, tetrahydro-2-methyl- 841.0 kJ/mol
Germane 713.4 kJ/mol
Glycine 886.6 kJ/mol
Glycylglycylglycylglycine 973.6 kJ/mol
Guanidine 986.2 kJ/mol
guanosine 993.3 kJ/mol
H2C=Te 795.8 kJ/mol
H2NCH2CH2CN 866.5 kJ/mol
H2N-NO2 757.3 kJ/mol
H2SiO 841.0 kJ/mol
H2SiOH 738.1 kJ/mol
H3PO3 821.3 kJ/mol
H3SiO 700.0 kJ/mol
H3SiOH 746.4 kJ/mol
HCCCH2CH()CCH 748.9 kJ/mol
HCOH (hydroxymethylene) 966.1 kJ/mol
HCOONH2 834.7 kJ/mol
Heptamethylenesulfide 860.6 kJ/mol
Histamine 1000.0 kJ/mol
HNCCCO 861.1 kJ/mol
HOCH2CH(OH)CH2CH2OH 905.8 kJ/mol
HSiO 810.0 kJ/mol
HSiOH 840.1 kJ/mol
Hydrazine 853.1 kJ/mol
Hydrazine, 1,1-dimethyl- 927.2 kJ/mol
Hydrazine, 1,2-dimethyl 1,2-dineopentyl- 977.8 kJ/mol
Hydrazine, 1,2-dimethyl-1,2-dipropyl 971.9 kJ/mol
Hydrazine, 1,2-di-isobutyl 1,2-dimethyl- 979.9 kJ/mol
Hydrazine, methyl- 898.7 kJ/mol
Hydrazine, N,N'-dibutyl-N,N'-dimethyl- 975.7 kJ/mol
Hydrazine, N,N'-dimethyl-N,N'-dipentyl- 977.4 kJ/mol
Hydrogen azide 756.0 kJ/mol
Hydrogen cyanide 713.0 kJ/mol
Hydrogen isocyanide 772.4 kJ/mol
Hydrogen selenide 707.9 kJ/mol
Hydrogen sulfide 705.0 kJ/mol
Hydrogen telluride 736.0 kJ/mol
Hydromanganese pentacarbonyl 835.5 kJ/mol
Hydroxylamine, o-methyl- 844.7 kJ/mol
Hypoxanthine 912.1 kJ/mol
i-C3H7(C6H5)2PO 908.8 kJ/mol
i-C3H7CON(CH3)2 923.8 kJ/mol
Imidazo[1,2-a]pyridine 971.9 kJ/mol
Indene 848.9 kJ/mol
Indole 933.5 kJ/mol
Iodoethane 724.7 kJ/mol
Iron 754.0 kJ/mol
Iron monoxide 907.1 kJ/mol
Iron pentacarbonyl 833.0 kJ/mol
Iron, methylene- 937.6 kJ/mol
Iron,methyldicarbonyl-?5-cyclopentadienyl 792.0 kJ/mol
Isocyanic acid 753.1 kJ/mol
Isoleucine 917.6 kJ/mol
Isopropyl alcohol 792.9 kJ/mol
Iso-propyl nitrite 845.6 kJ/mol
Isoquinoline 951.9 kJ/mol
Isoquinoline, 5,6,7,8-tetrahydro- 966.5 kJ/mol
Isoxazole 848.5 kJ/mol
Ketene 825.5 kJ/mol
Lanthanum 1012.9 kJ/mol
L-Arginine 1051.0 kJ/mol
L-Asparagine 928.8 kJ/mol
L-Cysteine 903.3 kJ/mol
Leucine 914.6 kJ/mol
L-Glutamic acid 912.9 kJ/mol
L-Glutamine 937.6 kJ/mol
L-Histidine 987.8 kJ/mol
LiOH 1000.0 kJ/mol
Lithium bromide 818.8 kJ/mol
Lithium chloride 827.2 kJ/mol
Lithium dimer 1161.9 kJ/mol
Lithium hydride 1021.7 kJ/mol
L-Methionine 935.5 kJ/mol
L-Phenylalanine 923.0 kJ/mol
L-Serine 914.6 kJ/mol
L-Tryptophan 948.9 kJ/mol
Lutetium 992.0 kJ/mol
Lysine 995.8 kJ/mol
Magnesium 819.6 kJ/mol
Magnesium dimer 918.8 kJ/mol
Magnesium monoxide 987.8 kJ/mol
Malononitrile 723.0 kJ/mol
Manganese 797.5 kJ/mol
Manganese, pentacarbonylmethyl- 764.4 kJ/mol
Manganese, tricarbonyl[(1,2,3,4,5-?5)-1-methyl-2,4-cyclopentadien-1-yl]- 833.9 kJ/mol
m-Chloroaniline 868.2 kJ/mol
Mercaptomethyl radical 733.9 kJ/mol
Mercury, dimethyl- 771.5 kJ/mol
Methacrylamide 880.3 kJ/mol
Methanamine, N,N-dimethyl-, N-oxide 983.2 kJ/mol
Methanamine, N-methyl- 929.7 kJ/mol
Methanamine, N-methyl-N-nitro- 828.4 kJ/mol
Methane, diazo- 859.0 kJ/mol
Methane, isocyano- 838.9 kJ/mol
Methane, isocyanato- 764.4 kJ/mol
Methane, isothiocyanato- 799.1 kJ/mol
Methane, nitro- 754.8 kJ/mol
Methanediamine, N,N,N',N'-tetramethyl- 952.3 kJ/mol
Methanethioamide, N,N-dimethyl- 906.3 kJ/mol
Methanethiol 773.2 kJ/mol
Methanimine 852.7 kJ/mol
Methanone, dicyclopropyl- 880.3 kJ/mol
Methinophosphide 699.1 kJ/mol
Methoxyacetonitrile 758.1 kJ/mol
Methyl alcohol 754.4 kJ/mol
Methyl azide 833.0 kJ/mol
Methyl diazene 845.2 kJ/mol
Methyl dithioacetate 860.6 kJ/mol
Methyl formate 782.4 kJ/mol
Methyl nicotinate 925.5 kJ/mol
Methyl nitrate 733.5 kJ/mol
Methyl nitrite 798.7 kJ/mol
Methyl propyl ether 815.0 kJ/mol
Methyl radical, methoxy- 756.0 kJ/mol
Methyl rhenium pentacarbonyl 774.9 kJ/mol
Methyl vinyl ketone 834.7 kJ/mol
Methyl vinyl sulfide 858.1 kJ/mol
Methylamine 899.1 kJ/mol
Methyldodecahedrane 855.6 kJ/mol
Methylketene 834.3 kJ/mol
m-Methoxybenzamide 900.8 kJ/mol
Molybdenum hexacarbonyl 762.7 kJ/mol
Morpholine 924.2 kJ/mol
m-Toluamide 900.8 kJ/mol
N-(N-Glycylglycyl)glycine 966.9 kJ/mol
N,3,5-Trimethylpiperidine 978.2 kJ/mol
N,N,2,6-Tetramethylaniline,4-carboxylic acid, methyl ester 945.6 kJ/mol
N,N,2,6-Tetramethyl-4-nitroaniline 918.4 kJ/mol
N,N,2,6-Tetramethylaniline,4-bromo- 935.5 kJ/mol
N,N,2,6-Tetramethylaniline,4-fluoro 943.1 kJ/mol
N,N,2,6-Tetramethyl-4-cyanoaniline 913.4 kJ/mol
N,N,4-Trimethyl benzamide 927.2 kJ/mol
N,N,N',N',N",N'-Hexamethylphosphorotriamide 958.6 kJ/mol
N,N,N',N',N''-Pentamethylguanidine 1047.7 kJ/mol
N,N,N',N'-Tetramethylphosphorotriamide 947.7 kJ/mol
N,N,N',N'-Tetramethylguanidine 1031.8 kJ/mol
N,N,N'-Trimethyl-1,8-naphthalenediamine 984.5 kJ/mol
N,N'-Bipyrrolidine 979.9 kJ/mol
N,N-Di-(n-propyl)benzenamine 963.2 kJ/mol
N,N'-Diethyl-N,N'-dimethylhydrazine 963.6 kJ/mol
N,N-Dimethyl 4-methoxybenzamide 948.1 kJ/mol
N,N-Dimethyl isobutylamine 968.6 kJ/mol
N,N-Dimethyl p-chlorobenzamide 928.0 kJ/mol
N,N-Dimethyl p-fluorobenzamide 928.0 kJ/mol
N,N'-Dimethyl-1,8-naphthalenediamine 960.2 kJ/mol
N,N-Dimethyl-1-adamantylcarboxamide 949.3 kJ/mol
N,N-Dimethyl-2-pyridinamine 968.2 kJ/mol
N,N-Dimethyl-3-pyridinamine 969.4 kJ/mol
N,N-Dimethyl-4-fluoroaniline 924.7 kJ/mol
N,N-Dimethyladamantylamine 993.7 kJ/mol
N,N-Dimethylallyl amine 957.7 kJ/mol
N,N-Dimethylbenzenamine,2,4-di-t-butyl 973.2 kJ/mol
N,N-Dimethylbutyramide 921.7 kJ/mol
N,N-Dimethyl-p-trifluorobenzamide 904.6 kJ/mol
N,N-Dimethyl-tert-butylcarboxamide 927.2 kJ/mol
Naphthacene 905.4 kJ/mol
Naphthalene 802.9 kJ/mol
Naphthalene, 1-methyl- 834.7 kJ/mol
Naphthalene, 2-methyl- 831.8 kJ/mol
n-Butyl ether 845.6 kJ/mol
n-Butylpyrazole 928.8 kJ/mol
n-C3H7NHCHO 878.2 kJ/mol
NCC(CH3)CO 797.9 kJ/mol
NCCH2NH2 825.1 kJ/mol
NCCOOC2H5 745.6 kJ/mol
N'-cyano-N,N-dimethyl formamidine 889.5 kJ/mol
neo-C5H11CON(CH3)2 927.6 kJ/mol
Neopentyl, t-butyl amine 991.6 kJ/mol
Neopentylamine 928.4 kJ/mol
N-Ethyl-N-methylaniline 938.9 kJ/mol
NH2(CH2)4OH 984.5 kJ/mol
NH2(CH2)6OH 969.0 kJ/mol
Niacinamide 918.4 kJ/mol
Nickel 736.8 kJ/mol
Nickel tetracarbonyl 742.2 kJ/mol
Nickelocene 935.5 kJ/mol
Nikethamide 941.0 kJ/mol
Nitric acid 751.4 kJ/mol
Nitrous acid, ethyl ester 818.8 kJ/mol
N-Methyl methanimine 884.5 kJ/mol
Norbornan-7-one 832.2 kJ/mol
N-Phenylazetidine 933.0 kJ/mol
N-Phenylpiperidine 952.7 kJ/mol
N-Phenylpyrrolidine 941.4 kJ/mol
n-Propyl acetate 836.8 kJ/mol
O(CH2CH2CN)2 813.8 kJ/mol
o,o',o''-Trimethyl thiophosphate 883.7 kJ/mol
OP(CH2N(CH3)2)3 997.9 kJ/mol
OP(N(C2H5)2)3 974.9 kJ/mol
OP(N(CH3)2)(CH3)2 935.5 kJ/mol
OP(n-C3H7)3 948.1 kJ/mol
Oxazole 876.5 kJ/mol
Oxepane 834.3 kJ/mol
Oxetane 801.2 kJ/mol
o-Xylylene 898.7 kJ/mol
p-Aminobenzoic acid 864.8 kJ/mol
p-Benzoquinone 799.1 kJ/mol
p-CF3C6H4CHO 805.4 kJ/mol
p-Chloroaniline 873.6 kJ/mol
Pentaborane(9) 699.6 kJ/mol
Pentamethylphosphonic diamide 951.4 kJ/mol
Pentanal 796.6 kJ/mol
Pentane, 1,1'-oxybis- 852.7 kJ/mol
Pentanenitrile 802.5 kJ/mol
Perfluoro-tert-butylamine 783.7 kJ/mol
Perylene 888.7 kJ/mol
p-Fluoroaniline 871.5 kJ/mol
p-Fluorobenzamide 877.4 kJ/mol
Phenanthrene 825.5 kJ/mol
Phenanthrene, 1,2,3,4,5,6,7,8-octahydro- 846.0 kJ/mol
Phenazine 938.5 kJ/mol
Phenol 817.1 kJ/mol
Phenol, 2-amino- 898.7 kJ/mol
Phenol, 3-amino- 898.7 kJ/mol
Phenoxy radical 857.7 kJ/mol
Phenyl 3-pyridyl ketone 934.3 kJ/mol
Phenyl radical 884.1 kJ/mol
Phenylacetylene 832.2 kJ/mol
Phosphabenzene 817.6 kJ/mol
Phosphine 784.9 kJ/mol
Phosphine, dimethyl- 912.1 kJ/mol
Phosphine, methyl- 851.4 kJ/mol
Phosphine, methyldiphenyl- 971.9 kJ/mol
Phosphine, triethyl- 984.5 kJ/mol
Phosphine, trimethyl- 959.0 kJ/mol
Phosphine, triphenyl- 972.8 kJ/mol
Phosphino radical 709.2 kJ/mol
Phosphirane 802.5 kJ/mol
Phosphonic acid, dimethyl ester 895.0 kJ/mol
Phosphoric acid, trimethyl ester 890.8 kJ/mol
Phosphorothioic triamide, hexamethyl- 941.8 kJ/mol
Phosphorous acid, trimethyl ester 929.7 kJ/mol
Phosphorous triamide, hexamethyl- 930.1 kJ/mol
Phosphorus mononitride 789.5 kJ/mol
Phosphorus monosulfide 697.9 kJ/mol
Picene 851.4 kJ/mol
Piperazine 943.5 kJ/mol
Piperidine 954.0 kJ/mol
Piperidine, 1-(2-methyl-1-propenyl)- 978.2 kJ/mol
Piperidine, 1-(2-methylpropyl)- 974.5 kJ/mol
Piperidine, 1-carbonitrile- 876.5 kJ/mol
Piperidine, 1-methyl- 971.1 kJ/mol
Piperidine, 2,2,6,6-tetramethyl- 987.0 kJ/mol
p-Methoxybenzamide 900.4 kJ/mol
p-Nitroaniline 866.1 kJ/mol
Potassium hydroxide 1101.6 kJ/mol
Proline 920.5 kJ/mol
Propanal 786.2 kJ/mol
Propanal, 2-methyl- 797.5 kJ/mol
Propanamide 876.1 kJ/mol
Propanamide, 2,2-dimethyl- 889.1 kJ/mol
Propanamide, 2-methyl- 878.6 kJ/mol
Propanamide, N-methyl- 920.5 kJ/mol
Propane, 1,1'-thiobis- 864.8 kJ/mol
Propane, 1,3-dimethoxy- 897.0 kJ/mol
Propane, 1-isocyano- 856.9 kJ/mol
Propane, 1-methoxy-2,2-dimethyl- 825.9 kJ/mol
Propane, 2-ethoxy- 842.7 kJ/mol
Propane, 2-ethoxy-2-methyl- 856.0 kJ/mol
Propane, 2-methoxy-2-methyl- 841.4 kJ/mol
Propane, 2-methoxy- 826.3 kJ/mol
Propane, 2-methyl-2-(1-methylethoxy)- 870.7 kJ/mol
Propanenitrile 794.1 kJ/mol
Propanenitrile, 2,2-dimethyl- 810.9 kJ/mol
Propanenitrile, 2-methyl- 803.7 kJ/mol
Propanoic acid 797.1 kJ/mol
Propanoic acid, 2,2-dimethyl-, methyl ester 845.2 kJ/mol
Propanoic acid, 2-methyl-, methyl ester 836.8 kJ/mol
Propanoic acid, methyl ester 830.1 kJ/mol
Propargyl radical 741.0 kJ/mol
Propargylamine 887.4 kJ/mol
Propene 751.4 kJ/mol
Propiolonitrile 751.0 kJ/mol
Propylamine, 3,3,3-trifluoro- 887.0 kJ/mol
Propylene oxide 803.3 kJ/mol
Propyltrimethylhydrazine 966.9 kJ/mol
Propyne 748.1 kJ/mol
p-Toluidine 896.6 kJ/mol
p-Xylene 794.5 kJ/mol
Pyrazine 877.0 kJ/mol
Pyrazolidine, 1,2-dimethyl- 959.4 kJ/mol
Pyrene 869.0 kJ/mol
Pyridazine 907.1 kJ/mol
Pyridazine hexahydro-1,2-dimethyl- 966.1 kJ/mol
Pyridine 930.1 kJ/mol
Pyridine, 1-oxide 923.4 kJ/mol
Pyridine, 2-(methylthio)- 937.6 kJ/mol
Pyridine, 2,3-dimethyl- 959.0 kJ/mol
Pyridine, 2,4-dimethyl- 962.7 kJ/mol
Pyridine, 2,5-dimethyl- 959.0 kJ/mol
Pyridine, 2,6-dimethyl- 963.2 kJ/mol
Pyridine, 2-bromo- 905.0 kJ/mol
Pyridine, 2-chloro-6-methoxy- 910.0 kJ/mol
Pyridine, 2-chloro- 900.8 kJ/mol
Pyridine, 2-ethyl- 952.3 kJ/mol
Pyridine, 2-methyl- 948.9 kJ/mol
Pyridine, 2-methoxy- 934.7 kJ/mol
Pyridine, 3-(methylthio)- 936.4 kJ/mol
Pyridine, 3,4-dimethyl- 957.3 kJ/mol
Pyridine, 3,5-dimethyl- 955.2 kJ/mol
Pyridine, 3-bromo- 910.0 kJ/mol
Pyridine, 3-chloro- 903.3 kJ/mol
Pyridine, 3-methyl-, 1-oxide 935.1 kJ/mol
Pyridine, 3-methyl- 943.5 kJ/mol
Pyridine, 3-methoxy- 942.7 kJ/mol
Pyridine, 4-(1,1-dimethylethyl)- 957.7 kJ/mol
Pyridine, 4-(methylthio)- 955.2 kJ/mol
Pyridine, 4-ethenyl- 943.9 kJ/mol
Pyridine, 4-methyl- 947.3 kJ/mol
Pyridine, 4-methoxy- 961.9 kJ/mol
Pyridine, 4-trifluoromethyl- 893.7 kJ/mol
Pyridine, pentafluoro- 764.8 kJ/mol
Pyridine-1-oxide, 4-nitro- 868.2 kJ/mol
Pyridine-4-carboxylic acid, methyl ester 926.8 kJ/mol
Pyrrole 875.3 kJ/mol
Pyrrolidine 948.1 kJ/mol
Pyrrolidine, 1-(4-chlorophenyl) 937.2 kJ/mol
Pyrrolidine, 1-(1-cyclopenten-1-yl)- 1019.2 kJ/mol
Pyrrolidine, 1-(4-methoxyphenyl) 961.1 kJ/mol
Pyrrolidine, 1-(4-methylphenyl) 910.0 kJ/mol
Pyrrolidine, 1-methyl- 965.7 kJ/mol
Quinoline 953.1 kJ/mol
Quinoline, 1-oxide 943.5 kJ/mol
Quinoline, 5,6,7,8-tetrahydro- 966.1 kJ/mol
Quinoxaline 903.7 kJ/mol
Quinuclidine 983.2 kJ/mol
Rhodium 768.2 kJ/mol
Ruthenium 774.0 kJ/mol
Ruthenium, bis(?5-cyclopentadienyl) 899.1 kJ/mol
Sarcosine 921.3 kJ/mol
Scandium 914.2 kJ/mol
Silane, ethenyltrimethyl- 833.0 kJ/mol
Silane, methoxytrimethyl- 846.8 kJ/mol
Silane, trimethyl(3-phenyl-2-propenyl)- 878.6 kJ/mol
Silane,trimethyl(1-phenylethenyl)- 861.1 kJ/mol
Silanol, trimethyl 814.2 kJ/mol
Silicon 836.8 kJ/mol
Silicon monoxide 777.8 kJ/mol
Silylene 839.3 kJ/mol
SiNH 853.1 kJ/mol
SiOH 732.6 kJ/mol
SiS 710.0 kJ/mol
Sodium hydride 1095.0 kJ/mol
Sodium hydroxide 1071.9 kJ/mol
Stannane, tetramethyl- 823.8 kJ/mol
Stibine, triphenyl- 845.6 kJ/mol
Strontium monohydroxide 1019.2 kJ/mol
Strontium monoxide 1209.2 kJ/mol
Styrene 839.3 kJ/mol
Styrene, a-tert-butyl-p-(trifluoromethyl)- 825.5 kJ/mol
Sulfine 798.7 kJ/mol
Sulfone, methyl phenyl 812.5 kJ/mol
Sulfuric acid 699.6 kJ/mol
t-C4H9(C6H5)2PO 908.8 kJ/mol
Tert-butyl isocyanide 870.7 kJ/mol
Tert-butyl trimethylhydrazine 968.6 kJ/mol
Tetraborane(8) 784.9 kJ/mol
Tetraethylhydrazine 964.4 kJ/mol
Tetralin 809.6 kJ/mol
Tetramethylhydrazine 948.5 kJ/mol
Thiazole 904.2 kJ/mol
Thietane 834.7 kJ/mol
Thiirane 807.5 kJ/mol
Thiirane, methyl- 833.5 kJ/mol
Thioacetic acid, o-ethyl ester 863.6 kJ/mol
thiocamphor 884.1 kJ/mol
Thiocyanato radical 751.0 kJ/mol
Thiocyanic acid, methyl ester 796.6 kJ/mol
Thioformaldehyde 759.8 kJ/mol
Thioketene 826.3 kJ/mol
Thiophene 815.0 kJ/mol
Thiophene, 2-methyl- 859.0 kJ/mol
Thiophene, tetrahydro- 848.9 kJ/mol
Thiourea 893.7 kJ/mol
Thiourea, N,N'-dimethyl- 925.9 kJ/mol
Thiourea, tetramethyl- 947.7 kJ/mol
Threonine 922.6 kJ/mol
Thymidine 948.1 kJ/mol
Thymine 880.7 kJ/mol
Titanium 876.1 kJ/mol
Toluene 784.1 kJ/mol
trans-1,3-cyclohexanol 828.4 kJ/mol
trans-1,4-dibenzylcyclohexane 805.8 kJ/mol
trans-1,4-diphenylcyclohexane 804.2 kJ/mol
trans-3-Aminobicyclo[2.2.2]octan-2-ol 933.0 kJ/mol
trans-Alpha,beta-penteneoic acid 823.4 kJ/mol
trans-CH3CH=CH-OC2H5 877.0 kJ/mol
trans-dimethylamino acrylonitrile 896.6 kJ/mol
Tributylamine 998.3 kJ/mol
Tricyclo[3.3.1.13,7]decane-1-amine 948.9 kJ/mol
Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, methyl ester 864.0 kJ/mol
Tricyclo[3.3.1.13,7]decane-1-carbonitrile 834.3 kJ/mol
tricyclo[4.4.0.03,8]decan-4-ol-5-amino, stereoisomer 948.9 kJ/mol
tricyclo[4.4.0.03,8]decan-4-ol-5-amino, stereoisomer 946.8 kJ/mol
Triethyl phosphate 909.2 kJ/mol
Triethylamine 982.0 kJ/mol
Triethylenediamine 963.6 kJ/mol
Trifluoronitrosomethane 703.3 kJ/mol
Trimethylamine 948.9 kJ/mol
Trimethylphosphine oxide 909.6 kJ/mol
Triphenylene 819.2 kJ/mol
Tris(2-methylallyl)amine 980.3 kJ/mol
Tris(dimethylamino)phosphine selenide 934.3 kJ/mol
Tungsten hexacarbonyl 758.1 kJ/mol
Tyrosine 925.9 kJ/mol
Uracil 872.8 kJ/mol
Uranium 995.4 kJ/mol
Urea, N,N'-dimethyl- 903.3 kJ/mol
Urea, tetramethyl- 930.5 kJ/mol
Uridine 947.7 kJ/mol
Valine 910.4 kJ/mol
Vanadium 859.4 kJ/mol
Vinyl radical 755.2 kJ/mol
vinylimine 912.1 kJ/mol
Yttrium 966.9 kJ/mol

Top

Last updated: 17:21 19/01/2012

Kore Technology Limited 2012